| |
3 IDITOS
| |
|
Behti Hawa Sa Tha Woh.mp3 |
4.97 MB |
|
| |
|
behti hawa sa.mp3 |
4.74 MB |
|
| |
|
Give Me Some Sunshine .mp3 |
4.38 MB |
|
| |
|
gungunati hai.mp3 |
3.92 MB |
|
| |
|
jab life ho out of.mp3 |
4.35 MB |
|
| |
|
jane na denge.mp3 |
3.37 MB |
|
| |
|
sari umar.mp3 |
3.9 MB |
|
|
| |
5-Ghantey-Mein-5-Crore-320Kbps(Songs.PK)
| |
|
[Songs.PK] 01 - Kya Wajah Thi Tere Jaane Ki.mp3 |
11.23 MB |
|
| |
|
[Songs.PK] 02 - Aaye Nahi Chain Kate Nahin.mp3 |
10.32 MB |
|
| |
|
[Songs.PK] 03 - O Sone Ke Kangna (Female).mp3 |
7.19 MB |
|
| |
|
[Songs.PK] 04 - Kamsin.mp3 |
8.11 MB |
|
| |
|
[Songs.PK] 05 - Mashah Allah Kya Kehna.mp3 |
7.95 MB |
|
| |
|
[Songs.PK] 06 - Yadein Yadein.mp3 |
11.65 MB |
|
| |
|
[Songs.PK] 07 - O Sone Ke Kangna (Male).mp3 |
7.11 MB |
|
| |
|
[Songs.PK] 08 - Kya Jadu Hai Yeh.mp3 |
10.59 MB |
|
| |
|
[Songs.PK] 09 - Zindagi Kahun.mp3 |
10.09 MB |
|
|
| |
7-Khoon-Maaf-128Kbps-2010(Songs.PK)
| |
|
Awaara.mp3 |
6.74 MB |
|
| |
|
Bekaraan.mp3 |
7.49 MB |
|
| |
|
Darling .mp3 |
4.41 MB |
|
| |
|
Dil Dil hai.mp3 |
3.78 MB |
|
| |
|
Doosri Darling.mp3 |
3.68 MB |
|
| |
|
O' Mama (Acoustic).mp3 |
1.71 MB |
|
| |
|
O' Mama.mp3 |
5.97 MB |
|
| |
|
Tere liye.mp3 |
6.54 MB |
|
| |
|
Yeshu.mp3 |
7.04 MB |
|
|
| |
A-Flat
| |
|
Chal Halke Halke.mp3 |
6.43 MB |
|
| |
|
Dil Kashi .mp3 |
6.69 MB |
|
| |
|
Dil Kashi.mp3 |
6.68 MB |
|
| |
|
Meetha Sa (partymap mix).mp3 |
6.29 MB |
|
| |
|
Meetha Sa (unplugged).mp3 |
6.58 MB |
|
| |
|
Meetha Sa Ishq.mp3 |
8.21 MB |
|
| |
|
Pyar Itna Na Kar.mp3 |
5.98 MB |
|
|
| |
aaazaan
| |
|
aazaan01(www.songs.pk).mp3 |
4.51 MB |
|
| |
|
aazaan02(www.songs.pk).mp3 |
5.41 MB |
|
| |
|
aazaan03(www.songs.pk).mp3 |
4.32 MB |
|
| |
|
aazaan04(www.songs.pk).mp3 |
5.45 MB |
|
| |
|
aazaan05(www.songs.pk).mp3 |
2.76 MB |
|
| |
|
aazaan06(www.songs.pk).mp3 |
5.59 MB |
|
| |
|
aazaan07(www.songs.pk).mp3 |
4.14 MB |
|
| |
|
aazaan08(www.songs.pk).mp3 |
6 MB |
|
| |
|
aazaan09(www.songs.pk).mp3 |
5.02 MB |
|
|
| |
Aa dekha zara
| |
|
aa dekhe jara (1).mp3 |
2.03 MB |
|
| |
|
aa dekhe jara (2).mp3 |
2.07 MB |
|
| |
|
aa dekhe jara (3).mp3 |
2.49 MB |
|
| |
|
aa dekhe jara (4).mp3 |
2.66 MB |
|
| |
|
aa dekhe jara.mp3 |
2.5 MB |
|
|
| |
Aakrosh
| |
Aage se right
| |
|
Akash 1.mp3 |
2.35 MB |
|
| |
|
Akash 2.mp3 |
2.28 MB |
|
| |
|
Akash 3.mp3 |
1.72 MB |
|
| |
|
Akash 4.mp3 |
2.3 MB |
|
|
| |
|
Isak Se Meetha (Dhol Mix).mp3 |
5.9 MB |
|
| |
|
Isak Se Meetha (Remix).mp3 |
5.08 MB |
|
| |
|
Isak Se Meetha.mp3 |
5.61 MB |
|
| |
|
Man Ki Mat.mp3 |
4.86 MB |
|
| |
|
Ramkatha.mp3 |
5.61 MB |
|
| |
|
Sasural Munia.mp3 |
6.39 MB |
|
| |
|
Sauda Hai Dil Ka (Encore).mp3 |
7.15 MB |
|
| |
|
Sauda Hai Dil Ka.mp3 |
7.13 MB |
|
|
| |
Aarakshan-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Aarakshan - 01 - Achha Lagta Hai.mp3 |
4.82 MB |
|
| |
|
[Songs.PK] Aarakshan - 02 - Mauka.mp3 |
5.78 MB |
|
| |
|
[Songs.PK] Aarakshan - 03 - Kaun Si Dor.mp3 |
6.54 MB |
|
| |
|
[Songs.PK] Aarakshan - 04 - Roshanee.mp3 |
5.48 MB |
|
| |
|
[Songs.PK] Aarakshan - 05 - Saans Albeli.mp3 |
6.53 MB |
|
| |
|
[Songs.PK] Aarakshan - 06 - Mauka - Remix.mp3 |
4.07 MB |
|
| |
|
Aarakshan - Cover.jpg |
114.9 KB |
|
|
| |
Aashayein
| |
|
[Songs.PK] Aashayein - 08 - Pal Mein Mila Jahan.mp3 |
6.45 MB |
|
| |
|
Ab Mujhko Jeena (Remix).mp3 |
5.55 MB |
|
| |
|
Ab Mujhko Jeena.mp3 |
6.54 MB |
|
| |
|
Chala Aaya Pyar.mp3 |
6.27 MB |
|
| |
|
Dilkash Dildaar Duniya (Remix).mp3 |
4.25 MB |
|
| |
|
Dilkash Dildaar Duniya.mp3 |
4.55 MB |
|
| |
|
Mera Jeena Hai Kya (Remix).mp3 |
7.56 MB |
|
| |
|
Mera Jeena Hai Kya.mp3 |
6.97 MB |
|
| |
|
Pal Mein Mila Jahan.mp3 |
6.14 MB |
|
| |
|
Rabba.mp3 |
5.18 MB |
|
| |
▼ And 2 files more
|
|
| |
Aashiqui.in-2011-128Kbps(Songs.PK)
| |
|
- Ishq Bada Sangdil.mp3 |
4.98 MB |
|
| |
|
[Songs.PK] Aashiqui.in - 10 - Ruk Ke Jaana (Reloaded! Remix).mp3 |
4.14 MB |
|
| |
|
Cinderella Se Bhi Pyari.mp3 |
3.81 MB |
|
| |
|
Ishq Bada Sangdil (Pure Plugins Remix).mp3 |
4.05 MB |
|
| |
|
Lichu Lichu.mp3 |
5.19 MB |
|
| |
|
Rango Bhari Yeh Raat.mp3 |
3.64 MB |
|
| |
|
Ruk Ke Jaana (Everytime I See You Mix).mp3 |
4.25 MB |
|
| |
|
Ruk Ke Jaana.mp3 |
4.41 MB |
|
| |
|
Tere Bina (Unplugged).mp3 |
4.49 MB |
|
| |
|
Tere Bina.mp3 |
4.19 MB |
|
|
| |
Aasma
| |
|
Aasma [DJLUV].mp3 |
10.15 MB |
|
| |
|
Chalte Rahein [DJLUV].mp3 |
10.58 MB |
|
| |
|
Man Bawra [DJLUV].mp3 |
12.47 MB |
|
| |
|
Ye Pal (Remix) [DJLUV].mp3 |
7.72 MB |
|
| |
|
Ye Pal [DJLUV].mp3 |
11.09 MB |
|
|
| |
Aazaan-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Aazaan - 01 - Afreen.mp3 |
4.51 MB |
|
| |
|
[Songs.PK] Aazaan - 02 - Khuda Ke liye.mp3 |
5.41 MB |
|
| |
|
[Songs.PK] Aazaan - 03 - Bismillah.mp3 |
4.32 MB |
|
| |
|
[Songs.PK] Aazaan - 04 - Habibi Habibi.mp3 |
5.45 MB |
|
| |
|
[Songs.PK] Aazaan - 05 - Azaan Theme.mp3 |
2.76 MB |
|
| |
|
[Songs.PK] Aazaan - 06 - Khuda Ke Liye (Remixed by Abhijit Vaghani).mp3 |
5.59 MB |
|
| |
|
[Songs.PK] Aazaan - 07 - Afreen (Dessert Mix by Abhijit Vaghani).mp3 |
4.14 MB |
|
| |
|
[Songs.PK] Aazaan - 08 - Afreen (DJ Suketu feat Pavan).mp3 |
5.3 MB |
|
| |
|
[Songs.PK] Aazaan - 09 - Afreen (Reprise).mp3 |
5.02 MB |
|
| |
|
Aazaan - Front Cover.jpg |
136.93 KB |
|
|
| |
Action-Replay
| |
|
Baki Main Bhool Gayi.mp3 |
4.67 MB |
|
| |
|
Chhan Ke Mohalla (Remix).mp3 |
5.52 MB |
|
| |
|
Chhan Ke Mohalla.mp3 |
6.26 MB |
|
| |
|
Dhak Dhak Dhak.mp3 |
5.23 MB |
|
| |
|
I Am Dog Gone Crazy.mp3 |
4.19 MB |
|
| |
|
Luk Chup Jaana.mp3 |
4.88 MB |
|
| |
|
Nakhre (Remix).mp3 |
5.71 MB |
|
| |
|
Nakhre.mp3 |
6.67 MB |
|
| |
|
O Bekhabar.mp3 |
5.3 MB |
|
| |
|
Tera Mera Pyaar (Remix).mp3 |
8.4 MB |
|
| |
▼ And 2 files more
|
|
| |
Agent-Vinod-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Agent Vinod - 01- I Will Do The Talking Tonight.mp3 |
4.93 MB |
|
| |
|
[Songs.PK] Agent Vinod - 02 - Pungi.mp3 |
4.82 MB |
|
| |
|
[Songs.PK] Agent Vinod - 03 - Raabta.mp3 |
4.82 MB |
|
| |
|
[Songs.PK] Agent Vinod - 04 - Agent Vinod (Theme).mp3 |
5.64 MB |
|
| |
|
[Songs.PK] Agent Vinod - 05 - I Will Do The Talking Tonight (Remix).mp3 |
5.47 MB |
|
| |
|
[Songs.PK] Agent Vinod - 06 - Raabta (Night In Motel).mp3 |
3.79 MB |
|
| |
|
[Songs.PK] Agent Vinod - 07 - Pungi (Remix).mp3 |
4.99 MB |
|
| |
|
[Songs.PK] Agent Vinod - 08 - Raabta (Kehte Hain Khuda Ne).mp3 |
5.42 MB |
|
| |
|
[Songs.PK] Agent Vinod - 09 - Raabta (Siyaah Raatein).mp3 |
5.4 MB |
|
| |
|
[Songs.PK] Agent Vinod - 10 - Dil Mera Muft Ka.mp3 |
5.1 MB |
|
| |
|
[Songs.PK] Agent Vinod - 11 - Dil Mera Muft Ka (Remix).mp3 |
4.59 MB |
|
|
| |
Agneepath-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Agneepath - 01 - Chikni Chameli.mp3 |
6.46 MB |
|
| |
|
[Songs.PK] Agneepath - 02 - O Saiyyan.mp3 |
5.09 MB |
|
| |
|
[Songs.PK] Agneepath - 03 - Gun Gun Guna.mp3 |
5.17 MB |
|
| |
|
[Songs.PK] Agneepath - 04 - Shah Ka Rutba.mp3 |
6.36 MB |
|
| |
|
[Songs.PK] Agneepath - 05 - Abhi Mujh Mein Kahin.mp3 |
6.68 MB |
|
| |
|
[Songs.PK] Agneepath - 06 - Deva Shree Ganesha.mp3 |
6.99 MB |
|
| |
|
Agneepath - Front - Cover.jpg |
89.57 KB |
|
|
| |
Agyaat
| |
|
agyaat (4).mp3 |
6.75 MB |
|
| |
|
agyaat (5).mp3 |
6.24 MB |
|
| |
|
agyaat (6).mp3 |
7.79 MB |
|
| |
|
agyaat.mp3 |
9.79 MB |
|
| |
|
Jai Shiv Bum Shambu .mp3 |
9.6 MB |
|
| |
|
Jungle Jungle.mp3 |
7.61 MB |
|
| |
|
Khoobsurat .mp3 |
8.31 MB |
|
|
| |
Aisha
| |
|
[Songs.PK] Aisha - 01 - Suno Aisha.mp3 |
6.08 MB |
|
| |
|
[Songs.PK] Aisha - 02 - Gal Mitthi Mitthi.mp3 |
5.99 MB |
|
| |
|
[Songs.PK] Aisha - 03 - Sham.mp3 |
6.64 MB |
|
| |
|
[Songs.PK] Aisha - 04 - Behke Behke.mp3 |
5.26 MB |
|
| |
|
[Songs.PK] Aisha - 05 - Lehrein.mp3 |
6.77 MB |
|
| |
|
[Songs.PK] Aisha - 06 - By the way.mp3 |
4.98 MB |
|
| |
|
[Songs.PK] Aisha - 07 - Gal Mitthi Mitthi (The Bombay Bounce Dhol Mix).mp3 |
5.67 MB |
|
| |
|
[Songs.PK] Aisha - 08 - Lehrein (The Bombay Bounce Lounge Mix).mp3 |
6.66 MB |
|
|
| |
Aishwarya
| |
|
01 Phool Dekha Phoolon Ka Rang.mp3 |
13.24 MB |
|
| |
|
02 Gila Badan Tera Pyaasa Ye.mp3 |
9.82 MB |
|
| |
|
03 Kaise Batlao Tujhe.mp3 |
12.19 MB |
|
| |
|
04 Jhoom Jhoom Jhoomte.mp3 |
8.82 MB |
|
| |
|
05 He Baby Baby Baby.mp3 |
8.87 MB |
|
| |
|
06 Sigwan I Like That.mp3 |
10.55 MB |
|
|
| |
Aiyyaa-128Kbps-2012(Songs.PK)
| |
|
[Songs.PK] - Aiyyaa - 01 - Dreamum Wakeupum.mp3 |
4.04 MB |
|
| |
|
[Songs.PK] - Aiyyaa - 02 - Sava Dollar (Lavni).mp3 |
5.54 MB |
|
| |
|
[Songs.PK] - Aiyyaa - 03 - Aga Bai.mp3 |
5.05 MB |
|
| |
|
[Songs.PK] - Aiyyaa - 04 - Mahek Bhi.mp3 |
5.82 MB |
|
| |
|
[Songs.PK] - Aiyyaa - 05 - What To Do.mp3 |
5.44 MB |
|
| |
|
[Songs.PK] - Aiyyaa - 06 - Wakda.mp3 |
4.88 MB |
|
|
| |
Ajab prem ki gajab kahani
| |
|
ajab prem ki gajab kahani (1).mp3 |
4.31 MB |
|
| |
|
ajab prem ki gajab kahani (3).mp3 |
2.76 MB |
|
| |
|
ajab prem ki gajab kahani (4).mp3 |
3.88 MB |
|
| |
|
ajab prem ki gajab kahani (5).mp3 |
4.69 MB |
|
| |
|
ajab prem ki gajab kahani (6).mp3 |
3.97 MB |
|
| |
|
apn to naiyan he.mp3 |
3.97 MB |
|
| |
|
tere hona laga hoon.mp3 |
4.71 MB |
|
| |
|
too jane naa.mp3 |
5.35 MB |
|
|
| |
Alladin
| |
|
Akash 1.mp3 |
2.75 MB |
|
| |
|
Akash 2.mp3 |
2.18 MB |
|
| |
|
Akash 3.mp3 |
2.58 MB |
|
| |
|
Akash 4.mp3 |
1.49 MB |
|
| |
|
Akash 5.mp3 |
1.6 MB |
|
|
| |
Allah-Ke-Banday
| |
|
[Songs.PK] - 01 - Allah Ke Banday - Maula.mp3 |
5.99 MB |
|
| |
|
[Songs.PK] - 02 - Allah Ke Banday - Kya Hawa Kya Badal.mp3 |
6.34 MB |
|
| |
|
[Songs.PK] - 03 - Allah Ke Banday - Rabba Rabba.mp3 |
3.39 MB |
|
| |
|
[Songs.PK] - 04 - Allah Ke Banday - Mayoos.mp3 |
6.86 MB |
|
| |
|
[Songs.PK] - 05 - Allah Ke Banday - Kaala Jaadu.mp3 |
5.69 MB |
|
| |
|
[Songs.PK] - 06 - Allah Ke Banday - Kya Hawa Kya Badal (Full Version).mp3 |
12.1 MB |
|
|
| |
All the best
| |
|
all the best (1).mp3 |
5.34 MB |
|
| |
|
all the best (2).mp3 |
4.85 MB |
|
| |
|
all the best (3).mp3 |
4.58 MB |
|
| |
|
all the best (4).mp3 |
4.78 MB |
|
| |
|
all the best.mp3 |
5.47 MB |
|
|
| |
Aloo Chaat
| |
3Idiots
| |
|
Behti Hawa Sa Tha Woh.mp3 |
4.97 MB |
|
| |
|
behti hawa sa.mp3 |
4.74 MB |
|
| |
|
Give Me Some Sunshine .mp3 |
4.38 MB |
|
| |
|
gungunati hai.mp3 |
3.92 MB |
|
| |
|
jab life ho out of.mp3 |
4.35 MB |
|
| |
|
jane na denge.mp3 |
3.37 MB |
|
| |
|
sari umar.mp3 |
3.9 MB |
|
|
| |
5-Ghantey-Mein-5-Crore-320Kbps(Songs.PK)
| |
|
[Songs.PK] 01 - Kya Wajah Thi Tere Jaane Ki.mp3 |
11.23 MB |
|
| |
|
[Songs.PK] 02 - Aaye Nahi Chain Kate Nahin.mp3 |
10.32 MB |
|
| |
|
[Songs.PK] 03 - O Sone Ke Kangna (Female).mp3 |
7.19 MB |
|
| |
|
[Songs.PK] 04 - Kamsin.mp3 |
8.11 MB |
|
| |
|
[Songs.PK] 05 - Mashah Allah Kya Kehna.mp3 |
7.95 MB |
|
| |
|
[Songs.PK] 06 - Yadein Yadein.mp3 |
11.65 MB |
|
| |
|
[Songs.PK] 07 - O Sone Ke Kangna (Male).mp3 |
7.11 MB |
|
| |
|
[Songs.PK] 08 - Kya Jadu Hai Yeh.mp3 |
10.59 MB |
|
| |
|
[Songs.PK] 09 - Zindagi Kahun.mp3 |
10.09 MB |
|
|
| |
7-Khoon-Maaf-128Kbps-2010(Songs.PK)
| |
|
Awaara.mp3 |
6.74 MB |
|
| |
|
Bekaraan.mp3 |
7.49 MB |
|
| |
|
Darling .mp3 |
4.41 MB |
|
| |
|
Dil Dil hai.mp3 |
3.78 MB |
|
| |
|
Doosri Darling.mp3 |
3.68 MB |
|
| |
|
O' Mama (Acoustic).mp3 |
1.71 MB |
|
| |
|
O' Mama.mp3 |
5.97 MB |
|
| |
|
Tere liye.mp3 |
6.54 MB |
|
| |
|
Yeshu.mp3 |
7.04 MB |
|
|
| |
Aa dekha zara
| |
|
aa dekhe jara (1).mp3 |
2.03 MB |
|
| |
|
aa dekhe jara (2).mp3 |
2.07 MB |
|
| |
|
aa dekhe jara (3).mp3 |
2.49 MB |
|
| |
|
aa dekhe jara (4).mp3 |
2.66 MB |
|
| |
|
aa dekhe jara.mp3 |
2.5 MB |
|
|
| |
Apartment
| |
|
[Songs.PK] Apartment - 03 - Ankhiya Na Mar.mp3 |
5.31 MB |
|
| |
|
[Songs.PK] Apartment - 04 - O Jaane Jaan Jaan.mp3 |
5.42 MB |
|
| |
|
[Songs.PK] Apartment - 05 - Ghar Dil Mein.mp3 |
5.24 MB |
|
| |
|
[Songs.PK] Apartment - 06 - O Jaane Jaan Jaan.mp3 |
5.35 MB |
|
| |
|
[Songs.PK] Apartment - 07 - Ankhiya Na Mar (Remix).mp3 |
5.51 MB |
|
| |
|
[Songs.PK] Apartment - 08 - Ye Hai Mumbai (Remix).mp3 |
4.22 MB |
|
| |
|
[Songs.PK] Apartment - 09 - Candy Man (Remix).mp3 |
3.95 MB |
|
| |
|
Apartment - Back.jpg |
260.68 KB |
|
| |
|
Apartment - Front.jpg |
263.2 KB |
|
| |
|
Candy Man.mp3 |
3.96 MB |
|
| |
|
Ye Hai Mumbai.mp3 |
4.03 MB |
|
|
| |
Atif-Meri Kahani
| |
|
atif meri kahani (1).mp3 |
2.22 MB |
|
| |
|
atif meri kahani (2).mp3 |
1.77 MB |
|
| |
|
atif meri kahani (3).mp3 |
2.65 MB |
|
| |
|
atif meri kahani (4).mp3 |
1.87 MB |
|
| |
|
atif meri kahani.mp3 |
1.6 MB |
|
|
| |
Badmaash-Company
| |
|
[Songs.PK] Badmaash Company - 01- Ayaashi.mp3 |
5.12 MB |
|
| |
|
[Songs.PK] Badmaash Company - 02 - Jingle Jingle.mp3 |
5.24 MB |
|
| |
|
[Songs.PK] Badmaash Company - 03 - Chaska.mp3 |
6.12 MB |
|
| |
|
[Songs.PK] Badmaash Company - 04 - Fakeera.mp3 |
5.44 MB |
|
| |
|
[Songs.PK] Badmaash Company - 05 - Badmaash Company.mp3 |
4.69 MB |
|
| |
|
[Songs.PK] Badmaash Company - 06 - Ayaashi (Remix).mp3 |
4.95 MB |
|
| |
|
[Songs.PK] Badmaash Company - 07 - Chaska (Remix).mp3 |
4.5 MB |
|
|
| |
Band-Baaja-Baaraat
| |
|
[Songs.PK] Band Baaja Baaraat - 01 - Ainvayi Ainvayi.mp3 |
5.23 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 02 -Tarkeebein.mp3 |
5.71 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 03 - Aadha Ishq.mp3 |
5.42 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 04 - Dum Dum.mp3 |
6 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 05 - Mitra.mp3 |
4.36 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 06 - Baari Barsi.mp3 |
5.68 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 07 - Band Baaja Baaraat (Theme).mp3 |
2.29 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 08 - Ainvayi (Dilli Club Mix).mp3 |
4.28 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 09 - Dum Dum (Sufi Mix).mp3 |
5.24 MB |
|
|
| |
Bandish
| |
|
[Songs.PK] Bandish - 02 - Bandish.mp3 |
4.34 MB |
|
| |
|
[Songs.PK] Bandish - 03 - Khuda Baksh.mp3 |
4.02 MB |
|
| |
|
[Songs.PK] Bandish - 04 - Tere Bin (Remix).mp3 |
5.02 MB |
|
| |
|
[Songs.PK] Bandish - 05 - Meethi Batein Teri.mp3 |
4.69 MB |
|
| |
|
[Songs.PK] Bandish - 06 - I Believe.mp3 |
3.77 MB |
|
| |
|
[Songs.PK] Bandish - 07 - Mahi.mp3 |
5.14 MB |
|
| |
|
[Songs.PK] Bandish - 08 - Dummadum.mp3 |
5.19 MB |
|
| |
|
Tere Bin.mp3 |
4.27 MB |
|
|
| |
Bbuddah-Hoga-Terra-Baap-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] 01 - Haal-E-Dil.mp3 |
6.29 MB |
|
| |
|
[Songs.PK] 02 - Bbudhah Hoga Terra Baap (Accapella).mp3 |
3.26 MB |
|
| |
|
Bbudhah Hoga Terra Baap (Dub Step).mp3 |
3.76 MB |
|
| |
|
Go Meera Go.mp3 |
8.11 MB |
|
| |
|
Main Chandigarh Di Star.mp3 |
4.39 MB |
|
|
| |
Bewafaai-Ka-Aalam
| |
|
[Songs.PK] Bewafaai Ka Aalam - 01 - Milun Kya Juda Reh Rahe Hain.mp3 |
7.44 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 02 - Apne Haathon Se Mujhe De Do.mp3 |
6.94 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 03 - Ishq Hai Dhokha Ishq.mp3 |
5.2 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 04 - Raat Katati Hai Taare Gin Gin Ke.mp3 |
6.51 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 05 - Aaj Ki Raat To Jee Bhar Ke Mujhe Rone De (F).mp3 |
7.56 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 06 - Main Zindagi Bhar Tera Intezar Karunga (F).mp3 |
6.52 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 07 - Khuda Ka Shukriya Ada Karta Hoon.mp3 |
6.68 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 08 - Beimaan Sanam Tha Beimaan Mohabbat.mp3 |
7.37 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 09 - Khatam Karta Hoon Par Khatam Hota Nahin Hai (M).mp3 |
8.17 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 10 - Bewafaai Ka Aalam Main Bataun Kisko.mp3 |
5.18 MB |
|
| |
|
Bewafaai Ka Aalam - Front Cover.jpg |
272.82 KB |
|
|
| |
Bhindi-Bazaar-Inc-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Bhindi Baazaar Inc - 01 - Akkad Bakkad.mp3 |
6.21 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 02 - Maaldaar Ki Jeb.mp3 |
4.08 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 03 - Aa Ja Re Piya.mp3 |
7.09 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 04 - Taan Ke Seena.mp3 |
5.76 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 05 - Kitni Baatein.mp3 |
5.94 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 06 - Akkad Bakkad (Remix).mp3 |
4.13 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 07 - Maaldaar Ki Jeb (Remix).mp3 |
5.25 MB |
|
|
| |
|
Akash 1.mp3 |
1.73 MB |
|
| |
|
Akash 2.mp3 |
2.5 MB |
|
| |
|
Akash 3.mp3 |
2.18 MB |
|
| |
|
Akash 4.mp3 |
2.02 MB |
|
| |
|
Akash 5.mp3 |
2.27 MB |
|
|
| |
Angel-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Angel - 05 - Tell Me Why.mp3 |
6.18 MB |
|
| |
|
Aye Khuda.mp3 |
6.64 MB |
|
| |
|
Aye Khuda1.mp3 |
6.57 MB |
|
| |
|
Phir Teri.mp3 |
5.5 MB |
|
| |
|
Rubaru (Kyun Faaslein Hai).mp3 |
6.06 MB |
|
| |
|
Titliyon Ki Phoor.mp3 |
5.2 MB |
|
|
| |
Anjaana-Anjaani
| |
|
Aas Paas Khuda (Unplugged).mp3 |
3.72 MB |
|
| |
|
Aas Paas Khuda.mp3 |
6.15 MB |
|
| |
|
Anjaana Anjaani Ki Kahani.mp3 |
5.88 MB |
|
| |
|
Anjaana Anjaani.mp3 |
7.01 MB |
|
| |
|
Hairat.mp3 |
5.24 MB |
|
| |
|
I Feel Good.mp3 |
6.13 MB |
|
| |
|
Tujhe Bhula Diya (Remix the Dance to Forget Mix).mp3 |
5.43 MB |
|
| |
|
Tujhe Bhula Diya.mp3 |
5.56 MB |
|
| |
|
Tumse Hi Tumse.mp3 |
5.47 MB |
|
|
| |
Apartment
| |
|
[Songs.PK] Apartment - 02 - Ye Hai Mumbai.mp3 |
4.03 MB |
|
| |
|
[Songs.PK] Apartment - 03 - Ankhiya Na Mar.mp3 |
5.31 MB |
|
| |
|
[Songs.PK] Apartment - 04 - O Jaane Jaan Jaan.mp3 |
5.42 MB |
|
| |
|
[Songs.PK] Apartment - 05 - Ghar Dil Mein.mp3 |
5.24 MB |
|
| |
|
[Songs.PK] Apartment - 06 - O Jaane Jaan Jaan.mp3 |
5.35 MB |
|
| |
|
[Songs.PK] Apartment - 07 - Ankhiya Na Mar (Remix).mp3 |
5.51 MB |
|
| |
|
[Songs.PK] Apartment - 08 - Ye Hai Mumbai (Remix).mp3 |
4.22 MB |
|
| |
|
[Songs.PK] Apartment - 09 - Candy Man (Remix).mp3 |
3.95 MB |
|
| |
|
Apartment - Back.jpg |
260.68 KB |
|
| |
|
Apartment - Front.jpg |
263.2 KB |
|
| |
|
Candy Man.mp3 |
3.96 MB |
|
|
| |
Athithi kab jaoge
| |
|
athiti kab jaoge (1).mp3 |
4.3 MB |
|
| |
|
athiti kab jaoge (2).mp3 |
4.44 MB |
|
| |
|
athiti kab jaoge (3).mp3 |
5.05 MB |
|
| |
|
athiti kab jaoge.mp3 |
2.57 MB |
|
|
| |
Atif-Meri Kahani
| |
|
atif meri kahani (1).mp3 |
2.22 MB |
|
| |
|
atif meri kahani (2).mp3 |
1.77 MB |
|
| |
|
atif meri kahani (3).mp3 |
2.65 MB |
|
| |
|
atif meri kahani (4).mp3 |
1.87 MB |
|
| |
|
atif meri kahani.mp3 |
1.6 MB |
|
|
| |
Badmaash-Company
| |
|
[Songs.PK] Badmaash Company - 01- Ayaashi.mp3 |
5.12 MB |
|
| |
|
[Songs.PK] Badmaash Company - 02 - Jingle Jingle.mp3 |
5.24 MB |
|
| |
|
[Songs.PK] Badmaash Company - 03 - Chaska.mp3 |
6.12 MB |
|
| |
|
[Songs.PK] Badmaash Company - 04 - Fakeera.mp3 |
5.44 MB |
|
| |
|
[Songs.PK] Badmaash Company - 05 - Badmaash Company.mp3 |
4.69 MB |
|
| |
|
[Songs.PK] Badmaash Company - 06 - Ayaashi (Remix).mp3 |
4.95 MB |
|
| |
|
[Songs.PK] Badmaash Company - 07 - Chaska (Remix).mp3 |
4.5 MB |
|
|
| |
Band-Baaja-Baaraat
| |
|
[Songs.PK] Band Baaja Baaraat - 01 - Ainvayi Ainvayi.mp3 |
5.23 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 02 -Tarkeebein.mp3 |
5.71 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 03 - Aadha Ishq.mp3 |
5.42 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 04 - Dum Dum.mp3 |
6 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 05 - Mitra.mp3 |
4.36 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 06 - Baari Barsi.mp3 |
5.68 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 07 - Band Baaja Baaraat (Theme).mp3 |
2.29 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 08 - Ainvayi (Dilli Club Mix).mp3 |
4.28 MB |
|
| |
|
[Songs.PK] Band Baaja Baaraat - 09 - Dum Dum (Sufi Mix).mp3 |
5.24 MB |
|
|
| |
Bandish
| |
|
[Songs.PK] Bandish - 02 - Bandish.mp3 |
4.34 MB |
|
| |
|
[Songs.PK] Bandish - 03 - Khuda Baksh.mp3 |
4.02 MB |
|
| |
|
[Songs.PK] Bandish - 04 - Tere Bin (Remix).mp3 |
5.02 MB |
|
| |
|
[Songs.PK] Bandish - 05 - Meethi Batein Teri.mp3 |
4.69 MB |
|
| |
|
[Songs.PK] Bandish - 06 - I Believe.mp3 |
3.77 MB |
|
| |
|
[Songs.PK] Bandish - 07 - Mahi.mp3 |
5.14 MB |
|
| |
|
[Songs.PK] Bandish - 08 - Dummadum.mp3 |
5.19 MB |
|
| |
|
Tere Bin.mp3 |
4.27 MB |
|
|
| |
basekpal
| |
|
bep01(songs.pk).mp3 |
4.15 MB |
|
| |
|
bep02(songs.pk).mp3 |
4.34 MB |
|
| |
|
bep03(songs.pk).mp3 |
4.36 MB |
|
| |
|
bep04(songs.pk).mp3 |
5.26 MB |
|
| |
|
bep05(songs.pk).mp3 |
4.12 MB |
|
| |
|
bep06(songs.pk).mp3 |
5.02 MB |
|
| |
|
bep07(songs.pk).mp3 |
4.38 MB |
|
| |
|
bep08(songs.pk).mp3 |
3.54 MB |
|
| |
|
bep09(songs.pk).mp3 |
4.89 MB |
|
|
| |
Bbuddah-Hoga-Terra-Baap-2011
| |
|
[Songs.PK] 01 - Haal-E-Dil.mp3 |
6.29 MB |
|
| |
|
[Songs.PK] 02 - Bbudhah Hoga Terra Baap (Accapella).mp3 |
3.26 MB |
|
| |
|
Bbudhah Hoga Terra Baap (Dub Step).mp3 |
3.76 MB |
|
| |
|
Go Meera Go.mp3 |
8.11 MB |
|
| |
|
Main Chandigarh Di Star.mp3 |
4.39 MB |
|
|
| |
Bewafaai-Ka-Aalam
| |
|
[Songs.PK] Bewafaai Ka Aalam - 01 - Milun Kya Juda Reh Rahe Hain.mp3 |
7.44 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 02 - Apne Haathon Se Mujhe De Do.mp3 |
6.94 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 03 - Ishq Hai Dhokha Ishq.mp3 |
5.2 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 04 - Raat Katati Hai Taare Gin Gin Ke.mp3 |
6.51 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 05 - Aaj Ki Raat To Jee Bhar Ke Mujhe Rone De (F).mp3 |
7.56 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 06 - Main Zindagi Bhar Tera Intezar Karunga (F).mp3 |
6.52 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 07 - Khuda Ka Shukriya Ada Karta Hoon.mp3 |
6.68 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 08 - Beimaan Sanam Tha Beimaan Mohabbat.mp3 |
7.37 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 09 - Khatam Karta Hoon Par Khatam Hota Nahin Hai (M).mp3 |
8.17 MB |
|
| |
|
[Songs.PK] Bewafaai Ka Aalam - 10 - Bewafaai Ka Aalam Main Bataun Kisko.mp3 |
5.18 MB |
|
| |
|
Bewafaai Ka Aalam - Front Cover.jpg |
272.82 KB |
|
|
| |
Bhindi-Bazaar-Inc-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Bhindi Baazaar Inc - 01 - Akkad Bakkad.mp3 |
6.21 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 02 - Maaldaar Ki Jeb.mp3 |
4.08 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 03 - Aa Ja Re Piya.mp3 |
7.09 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 04 - Taan Ke Seena.mp3 |
5.76 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 05 - Kitni Baatein.mp3 |
5.94 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 06 - Akkad Bakkad (Remix).mp3 |
4.13 MB |
|
| |
|
[Songs.PK] Bhindi Baazaar Inc - 07 - Maaldaar Ki Jeb (Remix).mp3 |
5.25 MB |
|
|
| |
Billoo Barber
| |
|
billu barber (1).mp3 |
2.33 MB |
|
| |
|
billu barber (2).mp3 |
2.29 MB |
|
| |
|
billu barber (3).mp3 |
2.43 MB |
|
| |
|
billu barber (4).mp3 |
2.83 MB |
|
| |
|
billu barber.mp3 |
2.62 MB |
|
| |
|
love mera hit hit.mp3 |
2.16 MB |
|
|
| |
Bin-Bulaye-Baraati-2011-320Kbps(Songs.PK)
| |
|
[Songs.PK] Bin Bulaye Baraati - 01 - Shalu.mp3 |
7.31 MB |
|
| |
|
[Songs.PK] Bin Bulaye Baraati - 02 - Dil Ka Achar.mp3 |
6.54 MB |
|
| |
|
[Songs.PK] Bin Bulaye Baraati - 03 - Kismat.mp3 |
6.7 MB |
|
| |
|
[Songs.PK] Bin Bulaye Baraati - 04 - Bin Bulaye Baraati.mp3 |
6.12 MB |
|
| |
|
[Songs.PK] Bin Bulaye Baraati - 05 - Sawan Ka Tha Mahina.mp3 |
7.07 MB |
|
|
| |
Blood-Money-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Blood Money - 01 - Chaahat.mp3 |
5.05 MB |
|
| |
|
[Songs.PK] Blood Money - 02 - Gunaah.mp3 |
5.97 MB |
|
| |
|
[Songs.PK] Blood Money - 03 - Teri Yaadon Se.mp3 |
5.21 MB |
|
| |
|
[Songs.PK] Blood Money - 04 - Jo Tere Sang.mp3 |
5.99 MB |
|
| |
|
[Songs.PK] Blood Money - 05 - Arzoo.mp3 |
5.08 MB |
|
| |
|
[Songs.PK] Blood Money - 06 - Gunaah (Unplugged).mp3 |
6.16 MB |
|
| |
|
[Songs.PK] Blood Money - 07 - Teri Yaadon Se (Remix).mp3 |
6.08 MB |
|
|
| |
Blue
| |
|
BLUE (1).mp3 |
4.24 MB |
|
| |
|
BLUE (2).mp3 |
4.9 MB |
|
| |
|
BLUE (3).mp3 |
5.15 MB |
|
| |
|
BLUE (4).mp3 |
5.12 MB |
|
| |
|
BLUE (5).mp3 |
5.09 MB |
|
| |
|
BLUE.mp3 |
4.17 MB |
|
|
| |
Bodyguard-2011-128Kbps(Songs.PK)
| |
|
Bodyguard (Title Track Remix).mp3 |
4.25 MB |
|
| |
|
Bodyguard (Title Track).mp3 |
4.51 MB |
|
| |
|
Desi Beat (Punjabi Hip Hop Mix).mp3 |
4.57 MB |
|
| |
|
Desi Beat (Remix).mp3 |
4.51 MB |
|
| |
|
Desi Beat.mp3 |
4.93 MB |
|
| |
|
I Love You (Remix).mp3 |
4.46 MB |
|
| |
|
I Love You (Unplugged).mp3 |
4.85 MB |
|
| |
|
I Love You.mp3 |
4.97 MB |
|
| |
|
Teri Meri (Remix).mp3 |
6.49 MB |
|
| |
|
Teri Meri (Reprise).mp3 |
3.97 MB |
|
| |
▼ And 1 file more
|
|
| |
bol
| |
|
bol01(www.songs.pk).mp3 |
4.27 MB |
|
| |
|
bol05(www.songs.pk).mp3 |
4.27 MB |
|
| |
|
bol06(www.songs.pk).mp3 |
4.69 MB |
|
| |
|
bol07(www.songs.pk).mp3 |
4.44 MB |
|
|
| |
Bol-2011-320Kbps(Songs.PK)
| |
|
01 - Bol - Hona Tha Pyar.mp3 |
6.91 MB |
|
| |
|
02 - Bol - Din Pareshan Hai.mp3 |
6.24 MB |
|
| |
|
03 - Bol - Dil Janiya .mp3 |
6.09 MB |
|
| |
|
04 - Bol - Saiyan Bolain.mp3 |
7.06 MB |
|
| |
|
05 - Bol - Mumkin Hai.mp3 |
7.18 MB |
|
| |
|
06 - Bol - Kaho (Aaj Bol Do).mp3 |
7.7 MB |
|
| |
|
07 - Bol - Din Pareshan Hai (Film Version).mp3 |
7.4 MB |
|
| |
|
08 - Bol - Bol Background Music.mp3 |
13.26 MB |
|
|
| |
Bol-Bachchan-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] 01 - Bol Bachchan.mp3 |
6.78 MB |
|
| |
|
[Songs.PK] 02 - Chalao Na Naino Se.mp3 |
6.65 MB |
|
| |
|
[Songs.PK] 03 - Nach Le Nach Le.mp3 |
5.5 MB |
|
| |
|
[Songs.PK] 04 - Jab Se Dekhi Hai.mp3 |
4.56 MB |
|
| |
|
[Songs.PK] 05 - Bol Bachchan (Remix).mp3 |
5.29 MB |
|
| |
|
[Songs.PK] 06 - Nach Le Nach Le (Remix).mp3 |
5.84 MB |
|
| |
|
[Songs.PK] 07 - Chalao Na Naino Se (Remix).mp3 |
5.09 MB |
|
| |
|
[Songs.PK] 08 - Jab Se Dekhi Hai (Remix).mp3 |
5.72 MB |
|
| |
|
Bol Bachchan - Cover.jpg |
505.62 KB |
|
|
| |
Break-Ke-Baad
| |
|
Adhoore (Remix).mp3 |
4.72 MB |
|
| |
|
Adhoore.mp3 |
5.02 MB |
|
| |
|
Ajab Leher.mp3 |
4.74 MB |
|
| |
|
Dhoop Ke Makaan (Acoustic).mp3 |
4.43 MB |
|
| |
|
Dhoop Ke Makaan.mp3 |
5.19 MB |
|
| |
|
Don't Worry About Me.mp3 |
3.4 MB |
|
| |
|
Dooriyan Hain Zaroori.mp3 |
4.76 MB |
|
| |
|
Main Jiyoonga.mp3 |
3.7 MB |
|
|
| |
Chalo-Dilli-2011-128Kbps(Songs.PK)
| |
|
Chalo Dilli.mp3 |
5.18 MB |
|
| |
|
Hi 5 (Club Mix).mp3 |
2.8 MB |
|
| |
|
Hi 5.mp3 |
3.66 MB |
|
| |
|
Kaun Si Badi Baat.mp3 |
5.57 MB |
|
| |
|
Laila (Club Mix).mp3 |
6.51 MB |
|
| |
|
Laila O Laila.mp3 |
7.02 MB |
|
| |
|
Matargashtiya.mp3 |
5.33 MB |
|
| |
|
Moments in Life.mp3 |
4.24 MB |
|
|
| |
Chance pe dance
| |
|
chance pe dance (1).mp3 |
4.54 MB |
|
| |
|
chance pe dance (2).mp3 |
1.91 MB |
|
| |
|
chance pe dance (3).mp3 |
3.88 MB |
|
| |
|
chance pe dance (4).mp3 |
4.11 MB |
|
| |
|
chance pe dance (5).mp3 |
3.74 MB |
|
| |
|
chance pe dance (6).mp3 |
3.87 MB |
|
| |
|
chance pe dance.mp3 |
3.45 MB |
|
|
| |
CHANDANI CHOWK TO CHINA
| |
|
01 S.I.D.H.U (By Vehle Jattz).mp3 |
9.95 MB |
|
| |
|
02Chandni Chowk To China (By Veh.mp3 |
8.31 MB |
|
| |
|
03 India Se Aaya Tera Dost (Aap Ki Khatir) (By Vehle Jatt.mp3 |
12.79 MB |
|
| |
|
04Tere Naina (By Vehle Jattz).mp3 |
7.94 MB |
|
| |
|
05 Chak Lein De (By Vehle Jattz).mp3 |
8.92 MB |
|
| |
|
06 C C 2 C (By Vehle Jattz).mp3 |
7.42 MB |
|
| |
|
07 Chandni Chowk To China (Remix) (By Vehle Jattz).mp3 |
10 MB |
|
| |
|
08 Chak Lein De (Remix) (By Vehle Jattz).mp3 |
9.65 MB |
|
|
| |
Chase-128Kbps(Songs.PK)
| |
|
[Songs.PK] Chase - 01 - Get Set Go.mp3 |
4.87 MB |
|
| |
|
[Songs.PK] Chase - 02 - Shaam Ki.mp3 |
5.76 MB |
|
| |
|
[Songs.PK] Chase - 03 - Ankahi Si.mp3 |
5.56 MB |
|
| |
|
[Songs.PK] Chase - 04 - Shaam Ki (Lounge Mix).mp3 |
4.56 MB |
|
| |
|
[Songs.PK] Chase - 05 - Get Set Go (Club Mix).mp3 |
4.69 MB |
|
|
| |
Chillar-Party-128Kbps-2011(Songs.PK)
| |
|
[Songs.PK] Chillar Party - 01 - Tai Tai Phish.mp3 |
4.32 MB |
|
| |
|
[Songs.PK] Chillar Party - 02 - Aa Rela Hai Apun.mp3 |
4.55 MB |
|
| |
|
[Songs.PK] Chillar Party - 03 - Chatte Batte.mp3 |
5.57 MB |
|
| |
|
[Songs.PK] Chillar Party - 04 - Ziddi Piddi.mp3 |
5.28 MB |
|
| |
|
[Songs.PK] Chillar Party - 05 - Ek School Banana Hai.mp3 |
5.02 MB |
|
| |
|
[Songs.PK] Chillar Party - 06 - Behla Do.mp3 |
4.67 MB |
|
| |
|
[Songs.PK] Chillar Party - 07 - Liar Liar.mp3 |
5.47 MB |
|
| |
|
[Songs.PK] Chillar Party - 08 - Chatte Batte Sad version.mp3 |
2.64 MB |
|
| |
|
Chillar Party - Back.jpg |
580.72 KB |
|
| |
|
Chillar Party - Front.jpg |
585.53 KB |
|
|
| |
Cigarette-Ki-Tarah-128Kbps-2012(Songs.PK)
| |
|
[Songs.PK] 01 - Doorian.mp3 |
3.8 MB |
|
| |
|
[Songs.PK] 02 - Hey Bhagwan.mp3 |
3.65 MB |
|
| |
|
[Songs.PK] 03 - Mujhko Khud Se.mp3 |
7.44 MB |
|
| |
|
[Songs.PK] 04 - Cigarette Ki Tarah.mp3 |
4.5 MB |
|
| |
|
[Songs.PK] 05 - Ye Bata Do Piya.mp3 |
5.71 MB |
|
| |
|
[Songs.PK] 06 - Doorian (Remix).mp3 |
4.52 MB |
|
|
| |
Click
| |
Dabangg-128Kbps(Songs.PK)
| |
|
Chori Kiya Re Jiya.mp3 |
5.84 MB |
|
| |
|
Dabangg Theme.mp3 |
2.57 MB |
|
| |
|
Hud Hud Dabangg.mp3 |
5.09 MB |
|
| |
|
Humka Peeni Hai (Remix).mp3 |
5.32 MB |
|
| |
|
Humka Peeni Hai.mp3 |
6.64 MB |
|
| |
|
Munni Badnaam (Remix).mp3 |
5.03 MB |
|
| |
|
Munni Badnaam.mp3 |
6.26 MB |
|
| |
|
Tere Mast Mast Do Na.mp3 |
7.02 MB |
|
| |
|
Tere Mast Mast Do Nain (Remix).mp3 |
5.8 MB |
|
| |
|
Tere Mast Mast Do Nain.mp3 |
7.02 MB |
|
|
| |
|
click (1).mp3 |
5.14 MB |
|
| |
|
click (2).mp3 |
4.73 MB |
|
| |
|
click (3).mp3 |
6.19 MB |
|
| |
|
click.mp3 |
4.85 MB |
|
|
| |
Cocktail-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Cocktail - 01 - Tum Hi Ho Bandhu.mp3 |
5.77 MB |
|
| |
|
[Songs.PK] Cocktail - 02 - Daaru Desi.mp3 |
5.51 MB |
|
| |
|
[Songs.PK] Cocktail - 03 - Yaariyaan.mp3 |
6.78 MB |
|
| |
|
[Songs.PK] Cocktail - 04 - Second Hand Jawaani.mp3 |
4.57 MB |
|
| |
|
[Songs.PK] Cocktail - 05 - Tera Naam Japdi Phiran.mp3 |
3.95 MB |
|
| |
|
[Songs.PK] Cocktail - 06 - Luttna (Saif Ul Malook).mp3 |
5.9 MB |
|
| |
|
[Songs.PK] Cocktail - 07 - Jugni.mp3 |
8.06 MB |
|
| |
|
[Songs.PK] Cocktail - 08 - Yaariyan (Reprise).mp3 |
5.53 MB |
|
| |
|
[Songs.PK] Cocktail - 09 - Luttna (Version 2).mp3 |
5.22 MB |
|
| |
|
[Songs.PK] Cocktail - 10 - Tera Naam Japdi Phiran (Version 2).mp3 |
4.81 MB |
|
|
| |
Crook-2010-128Kbps(Songs.PK)
| |
|
Challa (Remix-by Tigerstyle).mp3 |
5.52 MB |
|
| |
|
Challa.mp3 |
4.46 MB |
|
| |
|
Kya.mp3 |
4.69 MB |
|
| |
|
Mere Bina (Unplugged).mp3 |
5.75 MB |
|
| |
|
Mere Bina.mp3 |
5.71 MB |
|
| |
|
Tujhi Mein (Reprise).mp3 |
5.54 MB |
|
| |
|
Tujhi Mein.mp3 |
5.84 MB |
|
| |
|
Tujhko Jo Paaya.mp3 |
3.5 MB |
|
|
| |
Daddy cool
| |
|
daddy cool (1).mp3 |
2.56 MB |
|
| |
|
daddy cool (2).mp3 |
2.19 MB |
|
| |
|
daddy cool (3).mp3 |
1.87 MB |
|
| |
|
daddy cool.mp3 |
1.83 MB |
|
|
| |
Dam999-128Kbps-2011(Songs.PK)
| |
|
[Songs.PK] Dam 999 - 01 - Mujhe Chod Ke.mp3 |
6.15 MB |
|
| |
|
[Songs.PK] Dam 999 - 02 - Mujhe Chod Ke.mp3 |
6.2 MB |
|
| |
|
[Songs.PK] Dam 999 - 03 - Baath Yeh Kya.mp3 |
5.88 MB |
|
| |
|
[Songs.PK] Dam 999 - 04 - Dam999 Theme Song.mp3 |
4.94 MB |
|
| |
|
[Songs.PK] Dam 999 - 05 - Every Day.mp3 |
5.17 MB |
|
| |
|
[Songs.PK] Dam 999 - 06 - O My Queen.mp3 |
4.71 MB |
|
| |
|
[Songs.PK] Dam 999 - 07 - I Walk Away.mp3 |
5 MB |
|
| |
|
[Songs.PK] Dam 999 - 08 - Dakkanaga.mp3 |
5.54 MB |
|
| |
|
Dam 999 - Back Cover.jpg |
534.26 KB |
|
| |
|
Dam 999 - Front Cover.jpg |
604.24 KB |
|
|
| |
Damadamm-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Damadamm - 01 - Damadamm.mp3 |
7.02 MB |
|
| |
|
[Songs.PK] Damadamm - 02 - Umrao Jaan.mp3 |
5.18 MB |
|
| |
|
[Songs.PK] Damadamm - 03 - Aaja Ve.mp3 |
3.17 MB |
|
| |
|
[Songs.PK] Damadamm - 04 - Madhushala.mp3 |
5.53 MB |
|
| |
|
[Songs.PK] Damadamm - 05 - Yun Toh Mera Dil.mp3 |
3.48 MB |
|
| |
|
[Songs.PK] Damadamm - 06 - Hum Tum.mp3 |
6.66 MB |
|
| |
|
[Songs.PK] Damadamm - 07 - Tere Bina.mp3 |
6.61 MB |
|
| |
|
[Songs.PK] Damadamm - 08 - I Need My Space.mp3 |
5.9 MB |
|
| |
|
[Songs.PK] Damadamm - 09 - Mango.mp3 |
4.21 MB |
|
| |
|
[Songs.PK] Damadamm - 10 - Damadamm (Remix).mp3 |
6.03 MB |
|
| |
▼ And 6 files more
|
|
| |
Dangerous Ishq (2012) MP3 ~ 128 kbps
| |
|
01 Tu Hi Rab Tu Hi Dua.mp3 |
6.6 MB |
|
| |
|
02 Naina Re.mp3 |
5.21 MB |
|
| |
|
03 Ishq Mein Ruswaa.mp3 |
4.46 MB |
|
| |
|
04 Umeed.mp3 |
4.53 MB |
|
| |
|
05 Lagan Lagi More Piya.mp3 |
5.78 MB |
|
| |
|
06 Tu Hi Rab Tu Hi Dua (R&B Remix).mp3 |
4.51 MB |
|
| |
|
07 Naina Re (Remix).mp3 |
4.24 MB |
|
| |
|
08 Tu Hi Rab Tu Hi Dua (Reprise).mp3 |
4.49 MB |
|
| |
|
09 Umeed (Remix).mp3 |
3.87 MB |
|
| |
|
10 Naina Re (Reprise).mp3 |
5.19 MB |
|
| |
|
11 Ishq Mein Ruswaa (Remix).mp3 |
3.09 MB |
|
|
| |
De dana dan
| |
|
de dana dan (1).mp3 |
1.21 MB |
|
| |
|
de dana dan (2).mp3 |
1.24 MB |
|
| |
|
de dana dan (4).mp3 |
989.59 KB |
|
| |
|
de dana dan (5).mp3 |
1.03 MB |
|
| |
|
de dana dan.mp3 |
1.07 MB |
|
| |
|
mera pehla pyar.mp3 |
1.1 MB |
|
|
| |
de ghumake
| |
|
2012 (It Ain't The End).mp3 |
4.03 MB |
|
| |
|
Boom Boom Pow.mp3 |
5.69 MB |
|
| |
|
Chale Chalo.mp3 |
8.34 MB |
|
| |
|
De Ghumake .mp3 |
4.43 MB |
|
| |
|
I like It .mp3 |
3.73 MB |
|
| |
|
Jai Ho (Your are My Destiny) .mp3 |
4.39 MB |
|
| |
|
Just Dance (Deewan Mix) .mp3 |
5.07 MB |
|
| |
|
Khalbali.mp3 |
7.3 MB |
|
|
| |
delhi6
| |
|
delhi 6 (1).mp3 |
4.11 MB |
|
| |
|
delhi 6 (2).mp3 |
3.27 MB |
|
| |
|
delhi 6 (3).mp3 |
1.65 MB |
|
| |
|
delhi 6 (4).mp3 |
2.72 MB |
|
| |
|
delhi 6 (5).mp3 |
530.04 KB |
|
| |
|
delhi 6 (6).mp3 |
2.83 MB |
|
| |
|
delhi 6 (7).mp3 |
2.35 MB |
|
| |
|
delhi 6.mp3 |
1.78 MB |
|
| |
|
delhi605(www.songs.pk).mp3 |
2.9 MB |
|
|
| |
Delly belly
| |
|
[Songs.PK] Delhi Belly - 01 - Bhaag D.K. Bose, Aandhi Aayi.mp3 |
7.39 MB |
|
| |
|
[Songs.PK] Delhi Belly - 02 - Nakkaddwaley Disco, Udhaarwaley Khisko.mp3 |
6.76 MB |
|
| |
|
[Songs.PK] Delhi Belly - 03 - Saigal Blues.mp3 |
6.51 MB |
|
| |
|
[Songs.PK] Delhi Belly - 04 - Bedardi Raja.mp3 |
5.07 MB |
|
| |
|
[Songs.PK] Delhi Belly - 05 - Jaa Chudail.mp3 |
6.13 MB |
|
| |
|
[Songs.PK] Delhi Belly - 06 - Tere Siva.mp3 |
7.75 MB |
|
| |
|
[Songs.PK] Delhi Belly - 07 - Switty Tera Pyaar Chaida.mp3 |
5.17 MB |
|
| |
|
[Songs.PK] Delhi Belly - 08 - I Hate You (Like I Love You).mp3 |
10.48 MB |
|
| |
|
[Songs.PK] Delhi Belly - 09 - Bedardi Raja (Grind Mix).mp3 |
5.91 MB |
|
| |
|
[Songs.PK] Delhi Belly - 10 - Switty (Punk).mp3 |
6.66 MB |
|
|
| |
Desi-Boyz-128Kbps-2011(Songs.PK)
| |
|
[Songs.PK] Desi Boyz - 01 - Make Some Noise For The Desi Boyz.mp3 |
4.73 MB |
|
| |
|
[Songs.PK] Desi Boyz - 02 - Subha Hone Na De.mp3 |
5.55 MB |
|
| |
|
[Songs.PK] Desi Boyz - 03 - Jhak Maar Ke.mp3 |
4.95 MB |
|
| |
|
[Songs.PK] Desi Boyz - 04 - Allah Maaf Kare.mp3 |
4.76 MB |
|
| |
|
[Songs.PK] Desi Boyz - 05 - Let It Be.mp3 |
5.35 MB |
|
| |
|
[Songs.PK] Desi Boyz - 06 - Tu Mera Hero (Subha Hone Na De).mp3 |
5.39 MB |
|
| |
|
[Songs.PK] Desi Boyz - 07 - Allah Maaf Kare (Remix).mp3 |
5.52 MB |
|
| |
|
[Songs.PK] Desi Boyz - 09 - Jhak Mar Ke (Remix).mp3 |
3.62 MB |
|
| |
|
[Songs.PK] Desi Boyz - 09 - Subha Hone Na De (Remix).mp3 |
5.86 MB |
|
| |
|
[Songs.PK] Desi Boyz - 10 - Make Some Noise For The Desi Boyz (Remix).mp3 |
5.16 MB |
|
|
| |
Dev.D
| |
|
devd01(www.songs.pk).mp3 |
3.8 MB |
|
| |
|
devd02(www.songs.pk).mp3 |
1.77 MB |
|
| |
|
devd03(www.songs.pk).mp3 |
3.96 MB |
|
| |
|
devd04(www.songs.pk).mp3 |
2.9 MB |
|
| |
|
devd05(www.songs.pk).mp3 |
3.66 MB |
|
| |
|
devd06(www.songs.pk).mp3 |
4.24 MB |
|
| |
|
devd07(www.songs.pk).mp3 |
3.79 MB |
|
| |
|
devd08(www.songs.pk).mp3 |
3.82 MB |
|
| |
|
devd09(www.songs.pk).mp3 |
3.61 MB |
|
| |
|
devd10(www.songs.pk).mp3 |
2.32 MB |
|
| |
▼ And 7 files more
|
|
| |
Dil-Toh-Baccha-Hai-Ji
| |
|
Abhi Kuch Dino Se.mp3 |
5.71 MB |
|
| |
|
Dil Toh Baccha Hai Ji - 04 - Jadugari.mp3 |
5.76 MB |
|
| |
|
Dil Toh Baccha Hai Ji - 05 - Beshuba.mp3 |
5.21 MB |
|
| |
|
Tere Bin (Remix).mp3 |
6.17 MB |
|
| |
|
Tere Bin (Reprise).mp3 |
6.17 MB |
|
| |
|
Tere Bin.mp3 |
6.03 MB |
|
| |
|
Yeh Dil Hai Nakhrewala (Film Version).mp3 |
5.39 MB |
|
| |
|
Yeh Dil Hai Nakhrewala.mp3 |
5.04 MB |
|
|
| |
Dil bole hadiappa
| |
|
Akash 1.mp3 |
3.92 MB |
|
| |
|
Akash 2.mp3 |
4.2 MB |
|
| |
|
Akash 3.mp3 |
4.49 MB |
|
| |
|
Akash 4.mp3 |
3.14 MB |
|
| |
|
Akash 5.mp3 |
5.09 MB |
|
|
| |
Dil kabaddi
| |
|
Gaati Hai Jawani.mp3 |
6.23 MB |
|
| |
|
Keh Rahi Hai Raat.mp3 |
4.98 MB |
|
| |
|
Sun Balliye.mp3 |
4.82 MB |
|
| |
|
Tak Tak Dooron.mp3 |
5.53 MB |
|
|
| |
Dj-Aqeel-Forever
| |
|
Dum Maro Dum.mp3 |
6.39 MB |
|
| |
|
Ek Pal Ka Jeena.mp3 |
5.58 MB |
|
| |
|
Karz 2010 Theme.mp3 |
6.22 MB |
|
| |
|
Liya Liya Chura Liya.mp3 |
6.88 MB |
|
| |
|
Tera Saath Hai Kitna Pyara - Tume Aana Padega.mp3 |
3.75 MB |
|
| |
|
Tum Kya Jaano Mohabbat Kya Hai.mp3 |
4.41 MB |
|
| |
|
Yeh Wada Raha 2010 Mix (Yeh Wada Raha).mp3 |
5.62 MB |
|
|
| |
Do-Dooni-Chaar
| |
|
[Songs.PK] Do Dooni Chaar - 01 - Baaja Bajeya.mp3 |
5.93 MB |
|
| |
|
[Songs.PK] Do Dooni Chaar - 02 - Do Dooni Chaar.mp3 |
4.98 MB |
|
| |
|
[Songs.PK] Do Dooni Chaar - 03 - Ek Haath De.mp3 |
5.62 MB |
|
| |
|
[Songs.PK] Do Dooni Chaar - 04 - Maange Ki Ghodi.mp3 |
5.98 MB |
|
| |
|
[Songs.PK] Do Dooni Chaar - 05 - Do Dooni Chaar (Jam).mp3 |
2.28 MB |
|
| |
|
[Songs.PK] Do Dooni Chaar - 06 - Do Dooni Chaar (Club Mix).mp3 |
3.9 MB |
|
| |
|
[Songs.PK] Do Dooni Chaar - 07 - Ek Haath De (Dj Phukan Mix).mp3 |
5.81 MB |
|
|
| |
Do Knot Disturb
| |
|
01 - Zulfaen Khol Khal Ke.mp3 |
1.62 MB |
|
| |
|
02 - Don't Ever Leave Me.mp3 |
1.39 MB |
|
| |
|
03 - Mere Naal.mp3 |
1.85 MB |
|
| |
|
04 - Bebo.mp3 |
1.49 MB |
|
| |
|
05 - Beautiful Woman.mp3 |
1.1 MB |
|
| |
|
06 - Do Knot Disturb.mp3 |
1.01 MB |
|
|
| |
Don-2-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Don 2 - 01 - Zaraa Dil Ko Thaam Lo.mp3 |
5.52 MB |
|
| |
|
[Songs.PK] Don 2 - 01 - Aa Raha Hoon Palat Ke.mp3 |
797.85 KB |
|
| |
|
[Songs.PK] Don 2 - 03 - Hai Ye Maya.mp3 |
5.51 MB |
|
| |
|
[Songs.PK] Don 2 - 04 - Dushman Mera .mp3 |
4.74 MB |
|
| |
|
[Songs.PK] Don 2 - 05 - The King Is Back (Theme).mp3 |
4.68 MB |
|
| |
|
[Songs.PK] Don 2 - 06 - Mujhko Pehchaanlo.mp3 |
3.86 MB |
|
| |
|
[Songs.PK] Don 2 - 07 - Hai Yeh Maya (Remix).mp3 |
5.47 MB |
|
| |
|
[Songs.PK] Don 2 - 08 - Mujhko Pehchaanlo (Remix).mp3 |
5.29 MB |
|
| |
|
[Songs.PK] Don 2 - 09 - The 'Don' Waltz.mp3 |
4.37 MB |
|
| |
|
Don 2 - Back.jpg |
206.89 KB |
|
| |
|
Don 2 - Front.jpg |
195.16 KB |
|
|
| |
Dostana
| |
|
DOSTANA (1).mp3 |
2.01 MB |
|
| |
|
DOSTANA (2).mp3 |
2.26 MB |
|
| |
|
DOSTANA (3).mp3 |
2.48 MB |
|
| |
|
DOSTANA (4).mp3 |
2.25 MB |
|
| |
|
DOSTANA (5).mp3 |
2.11 MB |
|
| |
|
DOSTANA.mp3 |
2.74 MB |
|
|
| |
Double-Dhamaal-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Double Dhamaal - 01 - Chal Kudie.mp3 |
4.26 MB |
|
| |
|
[Songs.PK] Double Dhamaal - 02 - Oye Oye.mp3 |
5.06 MB |
|
| |
|
[Songs.PK] Double Dhamaal - 04 - Chill Maro.mp3 |
4.24 MB |
|
| |
|
[Songs.PK] Double Dhamaal - 05 - Chal Kudie (Remix).mp3 |
4.08 MB |
|
| |
|
[Songs.PK] Double Dhamaal - 06 - Oye Oye (Remix).mp3 |
4.98 MB |
|
| |
|
[Songs.PK] Double Dhamaal - 07 - Chill Maro (Remix).mp3 |
3.4 MB |
|
| |
|
Jalebi Bai.mp3 |
4.86 MB |
|
|
| |
Drona
| |
|
Akash 1.mp3 |
1.37 MB |
|
| |
|
Akash 2.mp3 |
1.37 MB |
|
| |
|
Akash 3.mp3 |
1.5 MB |
|
| |
|
Akash 4.mp3 |
1.12 MB |
|
| |
|
Akash 5.mp3 |
1.44 MB |
|
|
| |
Dulha mil gaya
| |
|
dulha mil gaya (1).mp3 |
2.91 MB |
|
| |
|
dulha mil gaya (2).mp3 |
2.61 MB |
|
| |
|
dulha mil gaya (3).mp3 |
2.53 MB |
|
| |
|
dulha mil gaya (4).mp3 |
2.71 MB |
|
| |
|
dulha mil gaya (5).mp3 |
2.29 MB |
|
| |
|
dulha mil gaya.mp3 |
2.44 MB |
|
|
| |
Dum-Maaro-Dum-2011-128Kbps(Songs.PK)
| |
|
Copy of Jiyein Kyun.mp3 |
5.18 MB |
|
| |
|
Jaana Hai.mp3 |
7.02 MB |
|
| |
|
Jiyein Kyun.mp3 |
5.18 MB |
|
| |
|
Mit Jaaye Gham (Dum Maaro Dum) .mp3 |
4.68 MB |
|
| |
|
Te Amo (Duet).mp3 |
5.79 MB |
|
| |
|
Te Amo (Female).mp3 |
5.8 MB |
|
| |
|
Te Amo (Remix by Kiron Kamath).mp3 |
5.83 MB |
|
| |
|
Te Amo (Reprise).mp3 |
5.51 MB |
|
| |
|
Thayn Thayn.mp3 |
4.39 MB |
|
|
| |
Dus-Tola
| |
|
[Songs.PK] Dus Tola - 01 - Aisa Hota Tha.mp3 |
4.92 MB |
|
| |
|
[Songs.PK] Dus Tola - 02 - Lal Lal Aag Hua.mp3 |
4.77 MB |
|
| |
|
[Songs.PK] Dus Tola - 03 - Tumse Kya Kehna.mp3 |
6.2 MB |
|
| |
|
[Songs.PK] Dus Tola - 04 - Jee Na Jalaiyo (Female).mp3 |
5.35 MB |
|
| |
|
[Songs.PK] Dus Tola - 05 - Jee Na Jalaiyo (Male).mp3 |
5.23 MB |
|
|
| |
Ek
| |
|
Akash 1.mp3 |
2.5 MB |
|
| |
|
Akash 2.mp3 |
2.13 MB |
|
| |
|
Akash 3.mp3 |
2.73 MB |
|
| |
|
Akash 4.mp3 |
2.77 MB |
|
|
| |
Ek-Ladki-Shabnami-Jaisi-Apoorv-2011
| |
|
[Songs.PK] Apoorv - 01 - Ek Ladki.mp3 |
6.99 MB |
|
| |
|
[Songs.PK] Apoorv - 02 - Teri Palkey.mp3 |
7.83 MB |
|
| |
|
[Songs.PK] Apoorv - 03 - Sau Raatein.mp3 |
5.45 MB |
|
| |
|
[Songs.PK] Apoorv - 04 - Do Pal.mp3 |
6.3 MB |
|
| |
|
[Songs.PK] Apoorv - 05 - Ya Khuda Ya Khuda.mp3 |
5.52 MB |
|
| |
|
[Songs.PK] Apoorv - 06 - Hey Diva.mp3 |
3.84 MB |
|
| |
|
[Songs.PK] Apoorv - 07 - Bematlab Thi Zindagi.mp3 |
5.14 MB |
|
|
| |
Ek-Main-Aur-Ekk-Tu-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] 01 - Ek Main Aur Ekk Tu.mp3 |
4.89 MB |
|
| |
|
[Songs.PK] 02 - Gubbare.mp3 |
5.24 MB |
|
| |
|
[Songs.PK] 03 - Aunty Ji.mp3 |
4.99 MB |
|
| |
|
[Songs.PK] 04 - Aahatein.mp3 |
4.68 MB |
|
| |
|
[Songs.PK] 05 - Kar Chalna Shuru Tu.mp3 |
5.37 MB |
|
| |
|
[Songs.PK] 06 - Ek Main Aur Ekk Tu (Remix).mp3 |
4.71 MB |
|
| |
|
[Songs.PK] 07 - Aahatein (Remix).mp3 |
4.22 MB |
|
| |
|
Ek Main Aur Ekk Tu - Front Cover.jpg |
145.84 KB |
|
|
| |
Ek-Tha-Tiger-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Ek Tha Tiger - 01 - MashAllah.mp3 |
6.02 MB |
|
| |
|
[Songs.PK] Ek Tha Tiger - 02 - Laapata.mp3 |
5.21 MB |
|
| |
|
[Songs.PK] Ek Tha Tiger - 03 - Banjaara.mp3 |
5.55 MB |
|
| |
|
[Songs.PK] Ek Tha Tiger - 04 - Saiyaara.mp3 |
4.9 MB |
|
| |
|
[Songs.PK] Ek Tha Tiger - 05 - Tiger's Theme.mp3 |
4.1 MB |
|
| |
|
[Songs.PK] Ek Tha Tiger - 06 - MashAllah (Remix).mp3 |
3.91 MB |
|
| |
|
[Songs.PK] Ek Tha Tiger - 07 - Laapata (Remix).mp3 |
4.28 MB |
|
| |
|
[Songs.PK] Ek Tha Tiger - 08 - Banjaara (Remix).mp3 |
4.13 MB |
|
|
| |
Ekk-Deewana-Tha-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] 01 - Ekk Deewana Tha - Kya Hai Mohabbat.mp3 |
4.85 MB |
|
| |
|
[Songs.PK] 02 - Ekk Deewana Tha - Dost Hai (Girl I Loved You).mp3 |
5 MB |
|
| |
|
[Songs.PK] 03 - Ekk Deewana Tha - Aromale (My Beloved).mp3 |
6.58 MB |
|
| |
|
[Songs.PK] 04 - Ekk Deewana Tha - Hosanna.mp3 |
6.57 MB |
|
| |
|
[Songs.PK] 05 - Ekk Deewana Tha - Phoolon Jaisi.mp3 |
6.16 MB |
|
| |
|
[Songs.PK] 06 - Ekk Deewana Tha - Sharminda Hoon.mp3 |
7.86 MB |
|
| |
|
[Songs.PK] 07 - Ekk Deewana Tha - Sunlo Zara.mp3 |
4.75 MB |
|
| |
|
[Songs.PK] 08 - Ekk Deewana Tha - Zohra-Jabeen.mp3 |
3.96 MB |
|
| |
|
[Songs.PK] 09 - Ekk Deewana Tha - Broken Promises.mp3 |
4.69 MB |
|
| |
|
[Songs.PK] 10 - Ekk Deewana Tha - Moments In Kerala.mp3 |
3.2 MB |
|
| |
▼ And 3 files more
|
|
| |
Ek Se Bure Do
| |
|
Aaisa Pehli Bar.mp3 |
10.8 MB |
|
| |
|
Ek Se Bure Do.mp3 |
9.22 MB |
|
| |
|
Ishq Ki Zaat.mp3 |
12.56 MB |
|
| |
|
Jaana Jaana.mp3 |
9.15 MB |
|
| |
|
Meri Har Ada Ke Charche.mp3 |
10.95 MB |
|
|
| |
F.A.L.T.U-2011-128Kbps(Songs.PK)
| |
|
Awaaz.mp3 |
5.37 MB |
|
| |
|
Char Baj Gayi.mp3 |
4.63 MB |
|
| |
|
Fully Faltu.mp3 |
5.65 MB |
|
| |
|
Gale Laga Le.mp3 |
4.94 MB |
|
| |
|
Le Ja Tu Mujhe.mp3 |
6.53 MB |
|
| |
|
Nayee Subah.mp3 |
4.5 MB |
|
| |
|
O Teri.mp3 |
3.87 MB |
|
| |
|
Percentage.mp3 |
5.29 MB |
|
| |
|
Rab Sab Se Sona.mp3 |
5 MB |
|
|
| |
Fashion
| |
|
Akash 1.mp3 |
4.42 MB |
|
| |
|
Akash 2.mp3 |
3.78 MB |
|
| |
|
Akash 3.mp3 |
5.13 MB |
|
| |
|
Akash 4.mp3 |
4.69 MB |
|
| |
|
Akash 5.mp3 |
3.78 MB |
|
|
| |
Force-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Force - 01 - Khwabon Khwabon.mp3 |
5.91 MB |
|
| |
|
[Songs.PK] Force - 02 - Chahoon Bhi.mp3 |
5.6 MB |
|
| |
|
[Songs.PK] Force - 03 - Dum Hai To Aaja.mp3 |
5.91 MB |
|
| |
|
[Songs.PK] Force - 04 - Main Chali.mp3 |
6.24 MB |
|
| |
|
[Songs.PK] Force - 05 - Dil Ki Hai Tamanna.mp3 |
6.67 MB |
|
| |
|
Force - Back Cover.jpg |
693.89 KB |
|
| |
|
Force - Front Cover.jpg |
739.65 KB |
|
|
| |
game
| |
|
[Songs.PK Game - 01 - It's a Game.mp3 |
3.79 MB |
|
| |
|
[Songs.PK Game - 02 - Maine Yeh Kab Socha Tha.mp3 |
5.98 MB |
|
| |
|
[Songs.PK Game - 04 - Kaun Hai Ajnabi.mp3 |
5.06 MB |
|
| |
|
[Songs.PK Game - 05 - It's a Game (Reprise).mp3 |
5.34 MB |
|
| |
|
[Songs.PK Game - 06 - Mehki Mehki (Remix).mp3 |
4.17 MB |
|
| |
|
[Songs.PK Game - 07 - Kaun Hai Ajnabi (Remix).mp3 |
4.33 MB |
|
| |
|
Mehki Mehki.mp3 |
5.06 MB |
|
|
| |
Ghajini
| |
|
ghajini (1).mp3 |
2.78 MB |
|
| |
|
ghajini (2).mp3 |
2.52 MB |
|
| |
|
ghajini (3).mp3 |
2.2 MB |
|
| |
|
ghajini (4).mp3 |
1.88 MB |
|
| |
|
ghajini.mp3 |
2.65 MB |
|
| |
|
kaise mujhe.mp3 |
5.41 MB |
|
|
| |
ghost
| |
|
ghost01(www.songs.pk).mp3 |
4.89 MB |
|
| |
|
ghost02(www.songs.pk).mp3 |
5.65 MB |
|
| |
|
ghost04(www.songs.pk).mp3 |
6.17 MB |
|
| |
|
ghost05(www.songs.pk).mp3 |
5.51 MB |
|
|
| |
God Tussi Great Ho
| |
|
God Tussi Great Ho - Remix.mp3 |
3.74 MB |
|
| |
|
God Tussi Great Ho.mp3 |
4.28 MB |
|
| |
|
Lal Chunariya.mp3 |
4.07 MB |
|
| |
|
Let-s Party - Remix.mp3 |
4.32 MB |
|
| |
|
Let-s Party.mp3 |
4.66 MB |
|
| |
|
Tujhe Aksa Beach Ghuma Doon - Remix.mp3 |
3.77 MB |
|
| |
|
Tujhe Aksa Beach Ghuma Doon.mp3 |
3.96 MB |
|
| |
|
Tumko Dekha.mp3 |
5.23 MB |
|
|
| |
Golmaal 3
| |
|
[Songs.PK] 01 - Golmaal - Golmaal.mp3 |
4.7 MB |
|
| |
|
Golmaal (Remix).mp3 |
5.25 MB |
|
| |
|
Golmaal - Ale.mp3 |
5.53 MB |
|
| |
|
Golmaal - Apna Har Din (Remix).mp3 |
4.66 MB |
|
| |
|
Golmaal - Apna Har Din.mp3 |
5.3 MB |
|
| |
|
Golmaal - Desi Kali (Remix).mp3 |
5.03 MB |
|
| |
|
Golmaal - Desi Kali.mp3 |
4.87 MB |
|
| |
|
Golmaal - Disco Dancer.mp3 |
5.51 MB |
|
| |
|
Golmaal - Yaad Aa Raha Hain.mp3 |
4.82 MB |
|
|
| |
Golmaal returns
| |
Guzaarish
| |
|
[Songs.PK] Guzaarish - 01 - Guzaarish.mp3 |
4.89 MB |
|
| |
|
[Songs.PK] Guzaarish - 02 - Sau Gram Zindagi.mp3 |
5.2 MB |
|
| |
|
[Songs.PK] Guzaarish - 03 - Tera Zikr.mp3 |
5.69 MB |
|
| |
|
[Songs.PK] Guzaarish - 04 - Saiba.mp3 |
3.86 MB |
|
| |
|
[Songs.PK] Guzaarish - 05 - Jaane Kiske Khwaab.mp3 |
3.32 MB |
|
| |
|
[Songs.PK] Guzaarish - 06 - Udi.mp3 |
4.17 MB |
|
| |
|
[Songs.PK] Guzaarish - 07 - Keh Na Saku.mp3 |
4.25 MB |
|
| |
|
[Songs.PK] Guzaarish - 08 - Chaand Ki Katori.mp3 |
6.6 MB |
|
| |
|
[Songs.PK] Guzaarish - 09 - Daayein Baayein.mp3 |
4.01 MB |
|
| |
|
[Songs.PK] Guzaarish - 10 - Dhundhli Dhundhli.mp3 |
4.33 MB |
|
|
| |
|
Akash 1.mp3 |
2.03 MB |
|
| |
|
Akash 2.mp3 |
1.73 MB |
|
| |
|
Akash 3.mp3 |
3.93 MB |
|
| |
|
Akash 4.mp3 |
4.21 MB |
|
| |
|
Akash 5.mp3 |
4.17 MB |
|
| |
|
Akash 6.mp3 |
4.8 MB |
|
| |
|
Akash 7.mp3 |
3.46 MB |
|
|
| |
Gumdhuda
| |
|
[Songs.PK] Gumshuda - 01 - Tanha Rahien.mp3 |
6.53 MB |
|
| |
|
[Songs.PK] Gumshuda - 02 - Dhundo.mp3 |
5.73 MB |
|
| |
|
[Songs.PK] Gumshuda - 03 - Kisne Pehchana.mp3 |
5.56 MB |
|
| |
|
[Songs.PK] Gumshuda - 04 - Chup Tha Paani.mp3 |
5.35 MB |
|
| |
|
[Songs.PK] Gumshuda - 05 - Is Mein Hai Chamak.mp3 |
4.63 MB |
|
| |
|
[Songs.PK] Gumshuda - 06 - Khasi Tingya.mp3 |
2.41 MB |
|
| |
|
[Songs.PK] Gumshuda - 07 - Dhundo (Remix).mp3 |
5.81 MB |
|
|
| |
Guzaarish-2010-128Kbps(Songs.PK)
| |
|
[Songs.PK] Guzaarish - 01 - Guzaarish.mp3 |
4.89 MB |
|
| |
|
[Songs.PK] Guzaarish - 02 - Sau Gram Zindagi.mp3 |
5.2 MB |
|
| |
|
[Songs.PK] Guzaarish - 03 - Tera Zikr.mp3 |
5.69 MB |
|
| |
|
[Songs.PK] Guzaarish - 04 - Saiba.mp3 |
3.86 MB |
|
| |
|
[Songs.PK] Guzaarish - 05 - Jaane Kiske Khwaab.mp3 |
3.32 MB |
|
| |
|
[Songs.PK] Guzaarish - 06 - Udi.mp3 |
4.17 MB |
|
| |
|
[Songs.PK] Guzaarish - 07 - Keh Na Saku.mp3 |
4.25 MB |
|
| |
|
[Songs.PK] Guzaarish - 08 - Chaand Ki Katori.mp3 |
6.6 MB |
|
| |
|
[Songs.PK] Guzaarish - 09 - Daayein Baayein.mp3 |
4.01 MB |
|
| |
|
[Songs.PK] Guzaarish - 10 - Dhundhli Dhundhli.mp3 |
4.33 MB |
|
|
| |
Hate-Story-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Hate Story - 01 - Mahe Jaan.mp3 |
6.86 MB |
|
| |
|
[Songs.PK] Hate Story - 02 - Dil Kanch Sa.mp3 |
7.33 MB |
|
| |
|
[Songs.PK] Hate Story - 03 - Raat.mp3 |
6.52 MB |
|
| |
|
[Songs.PK] Hate Story - 04 - Mahe Jaan (Rock Version).mp3 |
6.03 MB |
|
| |
|
[Songs.PK] Hate Story - 05 - Raat (Remix).mp3 |
5.03 MB |
|
| |
|
[Songs.PK] Hate Story - 06 - Dil Kanch Sa (Heart N Soul).mp3 |
7.37 MB |
|
| |
|
Hate Story - Cover.jpg |
189.58 KB |
|
|
| |
Haunted-3D-2011-320Kbps(Songs.PK)
| |
|
[Songs.PK] Haunted 3D - 01 - Tum Ho Mera Pyar.mp3 |
9.75 MB |
|
| |
|
[Songs.PK] Haunted 3D - 04 - Mujhe De De Har Gham Tera.mp3 |
9.35 MB |
|
| |
|
[Songs.PK] Haunted 3D - 05 - You're So Beautiful.mp3 |
8.29 MB |
|
| |
|
[Songs.PK] Haunted 3D - 06 - Sau Baras.mp3 |
8.85 MB |
|
| |
|
haunted02(www.songs.pk).mp3 |
5.79 MB |
|
| |
|
haunted03(www.songs.pk).mp3 |
6.9 MB |
|
|
| |
Hello
| |
|
Akash 2.mp3 |
2.41 MB |
|
| |
|
Akash 3.mp3 |
2.34 MB |
|
| |
|
Akash 4.mp3 |
2.53 MB |
|
| |
|
Akash 5.mp3 |
2.63 MB |
|
| |
|
hello.mp3 |
1.65 MB |
|
|
| |
Hello-Darling
| |
|
Aa Jaane Jaan Aa.mp3 |
4.02 MB |
|
| |
|
Attrah Baras Ki Bali.mp3 |
4.7 MB |
|
| |
|
Band Baaja Mein Tere Dar Pe (Remix).mp3 |
3.84 MB |
|
| |
|
Band Baaja Mein Tere Dar Pe.mp3 |
4.59 MB |
|
| |
|
Dil To Saala Ullu Ka.mp3 |
6.98 MB |
|
| |
|
Working Girls We Are.mp3 |
3.9 MB |
|
|
| |
Heroes
| |
|
Akash 1.mp3 |
2.48 MB |
|
| |
|
Akash 2.mp3 |
2.29 MB |
|
| |
|
Akash 3.mp3 |
2.64 MB |
|
| |
|
Akash 4.mp3 |
2.32 MB |
|
| |
|
Akash 5.mp3 |
2.87 MB |
|
| |
|
Akash 6.mp3 |
1.8 MB |
|
| |
|
Akash 7.mp3 |
425.55 KB |
|
|
| |
Heroine-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Heroine - 01 - Halkat Jawani.mp3 |
4.81 MB |
|
| |
|
[Songs.PK] Heroine - 02 - Saaiyaan.mp3 |
3.82 MB |
|
| |
|
[Songs.PK] Heroine - 03 - Main Heroine Hoon.mp3 |
3.98 MB |
|
| |
|
[Songs.PK] Heroine - 04 - Khwahishein.mp3 |
4.43 MB |
|
| |
|
[Songs.PK] Heroine - 05 - Tujhpe Fida.mp3 |
5.81 MB |
|
|
| |
Hisss
| |
|
Beyond The Snake.mp3 |
3.57 MB |
|
| |
|
Hisss - 10 - Kilimanjaro.mp3 |
6.33 MB |
|
| |
|
Hisss.mp3 |
3.58 MB |
|
| |
|
I Got That Poison.mp3 |
4.35 MB |
|
| |
|
Lafanaa.mp3 |
7.32 MB |
|
| |
|
Lagi Lagi Milan Dhun Lagi 2.mp3 |
7.46 MB |
|
| |
|
Lagi Lagi Milan Dhun Lagi.mp3 |
7.34 MB |
|
| |
|
Naina Miley.mp3 |
6.42 MB |
|
| |
|
Rishte Naate.mp3 |
5.63 MB |
|
| |
|
Sway.mp3 |
4.19 MB |
|
|
| |
Horn ok pleass
| |
|
Akash 1.mp3 |
2.71 MB |
|
| |
|
Akash 2.mp3 |
1.31 MB |
|
| |
|
Akash 3.mp3 |
1.93 MB |
|
| |
|
Akash 4.mp3 |
1.64 MB |
|
|
| |
HouseFull
| |
|
Aapka Kya Hoga (Dhanno).mp3 |
6.04 MB |
|
| |
|
I Don't Know What To Do (Shabbirs Sexy 70s Mix).mp3 |
4.72 MB |
|
| |
|
I Don't Know What To Do.mp3 |
4.11 MB |
|
| |
|
Loser.mp3 |
3.98 MB |
|
| |
|
Oh Girl You're Mine... (O Boy ! What a Girli Mix).mp3 |
4.67 MB |
|
| |
|
Oh Girl You're Mine....mp3 |
4.91 MB |
|
| |
|
Papa Jag Jayega (Insane Insomaniac Mix).mp3 |
4.61 MB |
|
| |
|
Papa Jag Jayega.mp3 |
4.23 MB |
|
|
| |
Housefull 2 (2012)[Mymp3den.com]
| |
|
01 - Papa Toh Band Bajaye[Mymp3den.com].mp3 |
4 MB |
|
| |
|
02 - Anarkali Disco Chali[Mymp3den.com].mp3 |
4.62 MB |
|
| |
|
03 - Right Now Now[Mymp3den.com].mp3 |
3.89 MB |
|
| |
|
04 - Do U Know[Mymp3den.com].mp3 |
5.05 MB |
|
| |
|
05 - Anarkali Disco Chali (Hyper Mix)[Mymp3den.com].mp3 |
4.45 MB |
|
| |
|
06 - Right Now Now (Remix)[Mymp3den.com].mp3 |
4.25 MB |
|
| |
|
07 - Do U Know (Remix)[Mymp3den.com].mp3 |
4.99 MB |
|
| |
|
08 - Anarkali Disco Chali (Remix)[Mymp3den.com].mp3 |
3.85 MB |
|
| |
|
Copy of 01 - Papa Toh Band Bajaye[Mymp3den.com].mp3 |
4 MB |
|
| |
|
Copy of 02 - Anarkali Disco Chali[Mymp3den.com].mp3 |
4.62 MB |
|
|
| |
Hum-Tum-Shabana-128Kbps-2011(Songs.PK)
| |
|
[Songs.PK] Hum Tum Shabana - 01 - Musik Bandh Na Karo.mp3 |
4.62 MB |
|
| |
|
[Songs.PK] Hum Tum Shabana - 02 - Hey Na Na Shabana.mp3 |
3.66 MB |
|
| |
|
[Songs.PK] Hum Tum Shabana - 03 - Thank U Mr DJ.mp3 |
5.37 MB |
|
| |
|
[Songs.PK] Hum Tum Shabana - 04 - Piya Kesariyo.mp3 |
5.12 MB |
|
| |
|
[Songs.PK] Hum Tum Shabana - 05 - Kaari Kaari.mp3 |
4.4 MB |
|
| |
|
[Songs.PK] Hum Tum Shabana - 06 - Hey Na Na Shabana (Party Map Remix).mp3 |
4.12 MB |
|
| |
|
[Songs.PK] Hum Tum Shabana - 07 - Musik Bandh Na Karo (Remix).mp3 |
5.65 MB |
|
| |
|
Hum Tum Shabana - Back Cover.jpg |
364.75 KB |
|
| |
|
Hum Tum Shabana - Front Cover.jpg |
410.55 KB |
|
|
| |
I-Am-Singh-2011-320Kbps(Songs.PK)
| |
|
[Songs.PK] I Am Singh - 01 - Dukaalang Pranaasi-Shabad.mp3 |
11.75 MB |
|
| |
|
[Songs.PK] I Am Singh - 02 - I Am Singh.mp3 |
12.79 MB |
|
| |
|
[Songs.PK] I Am Singh - 03 - Dhol Wajda.mp3 |
8.67 MB |
|
| |
|
[Songs.PK] I Am Singh - 04 - Kya Jeena.mp3 |
9.07 MB |
|
| |
|
[Songs.PK] I Am Singh - 05 - Channd Paragge.mp3 |
11.18 MB |
|
| |
|
[Songs.PK] I Am Singh - 06 - Dil Nayio Lagda.mp3 |
9.82 MB |
|
| |
|
[Songs.PK] I Am Singh - 07 - Doori Hai.mp3 |
3.24 MB |
|
| |
|
[Songs.PK] I Am Singh - 08 - Khanda Prithme Saajke-Chandi Di Waar.mp3 |
6.18 MB |
|
| |
|
[Songs.PK] I Am Singh - 09 - Turban Victory.mp3 |
8.42 MB |
|
| |
|
[Songs.PK] I Am Singh - 10 - I Am Singh (Video Edit).mp3 |
6.87 MB |
|
| |
|
I Am Singh - Front Cover.jpg |
86.06 KB |
|
|
| |
I-Hate-Luv-Story
| |
|
Bahara (Chill Version).mp3 |
4.79 MB |
|
| |
|
Bahara.mp3 |
6.63 MB |
|
| |
|
Bin Tere (Remix).mp3 |
6.53 MB |
|
| |
|
Bin Tere (Reprise).mp3 |
3.83 MB |
|
| |
|
Bin Tere.mp3 |
6.47 MB |
|
| |
|
I hate Luv Storys.mp3 |
5.97 MB |
|
| |
|
Jab Mila Tu.mp3 |
5.17 MB |
|
| |
|
Sadka Hua.mp3 |
6.77 MB |
|
|
| |
Impatient-Vivek
| |
|
Ek Pari Pagal Si (Love Reprise).mp3 |
6.52 MB |
|
| |
|
Ek Pari Pagal Si.mp3 |
5.67 MB |
|
| |
|
Impatient Vivek.mp3 |
5.27 MB |
|
| |
|
Ishq Musibat.mp3 |
4.39 MB |
|
| |
|
Khuraphat.mp3 |
5.84 MB |
|
| |
|
Meri Nindiya Udne.mp3 |
4.2 MB |
|
| |
|
Pal Hai Makhmali.mp3 |
5.49 MB |
|
| |
|
Tujhe Manga Hai (Remix).mp3 |
4.87 MB |
|
| |
|
Tujhe Manga Hai.mp3 |
5.58 MB |
|
| |
|
Ye Banda Mastkalandar.mp3 |
3.6 MB |
|
|
| |
Ishaqzaade-2012-320Kbps(Songs.PK)
| |
|
[Songs.PK] Ishaqzaade - 01 - Ishaqzaade.mp3 |
8.7 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 02 - Chokra Jawaan.mp3 |
8.54 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 04 - Jhalla Wallah.mp3 |
9.1 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 05 - Aafaton Ke Parinde.mp3 |
6.11 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 06 - Pareshaan (Remix).mp3 |
8.11 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 07 - Jhalla Wallah (Remix).mp3 |
7.41 MB |
|
| |
|
Pareshaan.mp3 |
8.22 MB |
|
|
| |
Ishqiya
| |
Ishaqzaade-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Ishaqzaade - 01 - Ishaqzaade.mp3 |
5.81 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 02 - Chokra Jawaan.mp3 |
5.44 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 03 - Pareshaan.mp3 |
5.15 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 04 - Jhalla Wallah.mp3 |
6.34 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 05 - Aafaton Ke Parinde.mp3 |
3.69 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 06 - Pareshaan (Remix).mp3 |
5.22 MB |
|
| |
|
[Songs.PK] Ishaqzaade - 07 - Jhalla Wallah (Remix).mp3 |
4.42 MB |
|
| |
|
Ishaqzaade - Front Cover.jpg |
423.47 KB |
|
|
| |
|
ISHQIYA (1).mp3 |
5.82 MB |
|
| |
|
ISHQIYA (2).mp3 |
3.97 MB |
|
| |
|
ISHQIYA (3).mp3 |
5.75 MB |
|
| |
|
ISHQIYA (4).mp3 |
6.9 MB |
|
| |
|
ISHQIYA (5).mp3 |
4.59 MB |
|
| |
|
ISHQIYA (6).mp3 |
4.38 MB |
|
| |
|
ISHQIYA.mp3 |
5.04 MB |
|
|
| |
Isi-Life-Mein
| |
|
[Songs.PK] Isi Life Mein - 01 - Isi Umar Mein.mp3 |
5.76 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 02 - Ramji 24x7.mp3 |
5.31 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 03 - Live Out Loud.mp3 |
6.3 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 04 - Tere Pyar Mein.mp3 |
7.61 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 05 - Banni Avela Tharo Banna.mp3 |
3.98 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 06 - Tum Darshan Hum Naina.mp3 |
3.83 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 07 - Apna Kaun Paraya Kaun.mp3 |
2.95 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 08 - Isi Umar Mein (Unplugged).mp3 |
4.96 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 09 - Ramji 24x7 (Remix).mp3 |
4.2 MB |
|
| |
|
[Songs.PK] Isi Life Mein - 10 - Taming Of The Shrew Reborn Theme.mp3 |
3.99 MB |
|
| |
▼ And 1 file more
|
|
| |
Jail
| |
|
Bareily Ke Bazaar Mein (Remix).mp3 |
4.93 MB |
|
| |
|
Bareily Ke Bazaar Mein.mp3 |
4.82 MB |
|
| |
|
Copy of Milke Yun Lagaa.mp3 |
5.16 MB |
|
| |
|
Daata Sun Le (Contemporary Remix) .mp3 |
4.79 MB |
|
| |
|
Daata Sun Le -.mp3 |
5.31 MB |
|
| |
|
Milke Yun Lagaa.mp3 |
5.16 MB |
|
| |
|
Sainya Ve (Remix) .mp3 |
4.11 MB |
|
| |
|
Sainya Ve (Rock Version) .mp3 |
5.08 MB |
|
| |
|
Sainya Ve .mp3 |
4.64 MB |
|
|
| |
Jai veeru
| |
|
Akash 1.mp3 |
2.49 MB |
|
| |
|
Akash 2.mp3 |
1.64 MB |
|
| |
|
Akash 3.mp3 |
2.48 MB |
|
| |
|
Akash 4.mp3 |
2.99 MB |
|
| |
|
Akash 5.mp3 |
2.47 MB |
|
|
| |
jalpari
| |
|
jalpari1(www.songs.pk).mp3 |
4.15 MB |
|
| |
|
jalpari10(www.songs.pk).mp3 |
2.78 MB |
|
| |
|
jalpari11(www.songs.pk).mp3 |
3.93 MB |
|
| |
|
jalpari2(www.songs.pk).mp3 |
3.54 MB |
|
| |
|
jalpari3(www.songs.pk).mp3 |
3.9 MB |
|
| |
|
jalpari4(www.songs.pk).mp3 |
3.81 MB |
|
| |
|
jalpari5(www.songs.pk).mp3 |
4.18 MB |
|
| |
|
jalpari6(www.songs.pk).mp3 |
4.73 MB |
|
| |
|
jalpari7(www.songs.pk).mp3 |
3.79 MB |
|
| |
|
jalpari8(www.songs.pk).mp3 |
5.29 MB |
|
| |
|
jalpari9(www.songs.pk).mp3 |
3.9 MB |
|
|
| |
Jannat-2-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Jannat 2 - 01 - Tu Hi Mera.mp3 |
5.52 MB |
|
| |
|
[Songs.PK] Jannat 2 - 02 - Jannat 2 - Tera Deedar Hua.mp3 |
6.81 MB |
|
| |
|
[Songs.PK] Jannat 2 - 03 - Tujhe Sochta Hoon.mp3 |
5.88 MB |
|
| |
|
[Songs.PK] Jannat 2 - 04 - Rab Ka Shukrana.mp3 |
5.6 MB |
|
| |
|
[Songs.PK] Jannat 2 - 05 - Jannatein Kahan.mp3 |
4.52 MB |
|
| |
|
[Songs.PK] Jannat 2 - 06 - Sang Hoon Tere.mp3 |
4.89 MB |
|
| |
|
[Songs.PK] Jannat 2 - 07 - Jannatein Kahan (Power Ballad).mp3 |
5.44 MB |
|
| |
|
[Songs.PK] Jannat 2 - 08 - Tera Deedar Hua (From The Heart).mp3 |
6.79 MB |
|
| |
|
[Songs.PK] Jannat 2 - 09 - Rab Ka Shukrana (Reprise).mp3 |
5.39 MB |
|
| |
|
Jannat 2 - Front Cover.jpg |
47.77 KB |
|
|
| |
Jashnn
| |
|
Akash 123.mp3 |
2.4 MB |
|
| |
|
Akash 2.mp3 |
2.66 MB |
|
| |
|
Akash 3.mp3 |
2.43 MB |
|
| |
|
Akash 4.mp3 |
2.28 MB |
|
| |
|
Akash 5.mp3 |
2.23 MB |
|
| |
|
Akash 6.mp3 |
2.63 MB |
|
|
| |
Jhoom-Ali-Zafar-128Kbps(Songs.PK)
| |
Jhootha-Hi-Sahi
| |
|
[Songs.PK] Jhootha Hi Sahi - 01 - Cry Cry.mp3 |
5.29 MB |
|
| |
|
[Songs.PK] Jhootha Hi Sahi - 02 - Maiyya Yashoda (Jamuna Mix).mp3 |
6.08 MB |
|
| |
|
[Songs.PK] Jhootha Hi Sahi - 03 - Hello Hello.mp3 |
4.11 MB |
|
| |
|
[Songs.PK] Jhootha Hi Sahi - 04 - Do Nishaaniyan.mp3 |
5.79 MB |
|
| |
|
[Songs.PK] Jhootha Hi Sahi - 05 - Pam Para.mp3 |
5.18 MB |
|
| |
|
[Songs.PK] Jhootha Hi Sahi - 06 - I'll Be Waiting.mp3 |
5.7 MB |
|
| |
|
[Songs.PK] Jhootha Hi Sahi - 07 - Maiyya Yashoda (Thames Mix).mp3 |
6.52 MB |
|
| |
|
[Songs.PK] Jhootha Hi Sahi - 08 - Do Nishaaniyan (Heartbreak Reprise).mp3 |
3.18 MB |
|
| |
|
[Songs.PK] Jhootha Hi Sahi - 09 - Call Me Dil.mp3 |
6.11 MB |
|
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 01 - Jhoom.mp3 |
8.06 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 02 - Tu Jaanay Na.mp3 |
5.09 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 03 - Jab Say Dekha Tujh Ko.mp3 |
2.98 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 04 - Jee Dhoondta Hai.mp3 |
6.79 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 05 - Koi Umeed.mp3 |
5.06 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 06 - Jaan-E-Man.mp3 |
4.52 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 07 - Nahin Ray Nahin.mp3 |
5.95 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 08 - Yar Dhadhi Ishq.mp3 |
7.82 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 09 - Dastan-E-Ishq.mp3 |
7.97 MB |
|
| |
|
[Songs.PK] Jhoom - Ali Zafar - 10 - Allah Hu.mp3 |
9.68 MB |
|
| |
▼ And 1 file more
|
|
| |
Jism-2-128Kbps-2012(Songs.PK)
| |
|
[Songs.PK] 01 - Jism 2 - Abhi Abhi (Male).mp3 |
6.62 MB |
|
| |
|
[Songs.PK] 02 - Jism 2 - Yeh Kasoor.mp3 |
7.1 MB |
|
| |
|
[Songs.PK] 03 - Jism 2 - Maula.mp3 |
5.91 MB |
|
| |
|
[Songs.PK] 04 - Jism 2 - Ye Jism.mp3 |
4.53 MB |
|
| |
|
[Songs.PK] 05 - Jism 2 - Darta Hoon (Adhoora).mp3 |
6.37 MB |
|
| |
|
[Songs.PK] 06 - Jism 2 - Abhi Abhi (Duet) Hum To Haare (Abhi Abhi).mp3 |
6.57 MB |
|
| |
|
[Songs.PK] 07 - Jism 2 - Hey Walla.mp3 |
4.75 MB |
|
|
| |
Josh-Beyond-Kismat-2011
| |
|
[Songs.PK] Josh - 01 - Pyar Ho Gaya.mp3 |
5.04 MB |
|
| |
|
[Songs.PK] Josh - 02 - Achi Ajeeb Ho Tum.mp3 |
4.22 MB |
|
| |
|
[Songs.PK] Josh - 03 - Meri Dua.mp3 |
5.3 MB |
|
| |
|
[Songs.PK] Josh - 04 - Zara Zara.mp3 |
4.34 MB |
|
| |
|
[Songs.PK] Josh - 05 - O Kurieh.mp3 |
3.98 MB |
|
| |
|
[Songs.PK] Josh - 06 - Hun Ta Mein Nachna.mp3 |
3.42 MB |
|
| |
|
[Songs.PK] Josh - 07 - Meri Raahon Mein.mp3 |
5.04 MB |
|
| |
|
[Songs.PK] Josh - 08 - Yeh Zameen.mp3 |
5 MB |
|
| |
|
[Songs.PK] Josh - 09 - Meri (Doosri) Dua.mp3 |
5.23 MB |
|
|
| |
Jugaad
| |
|
1.mp3 |
1.77 MB |
|
| |
|
2.mp3 |
2.46 MB |
|
|
| |
Kaashh.. Mere Hote
| |
|
01 Teri Naganee.mp3 |
4.38 MB |
|
| |
|
02 Mehbooba.mp3 |
3.91 MB |
|
| |
|
03 Teri Yaad.mp3 |
5.41 MB |
|
| |
|
04 Kaash Mere Hote (Female).mp3 |
4.89 MB |
|
| |
|
05 Rim Jhim Sawan.mp3 |
4.87 MB |
|
| |
|
06 Dil Ye Mera Dil.mp3 |
4.75 MB |
|
| |
|
07 Mast Bhara.mp3 |
4.43 MB |
|
| |
|
08 Kaash Mere Hote (Male).mp3 |
4.87 MB |
|
| |
|
09 Teri Naganee (remix).mp3 |
3.58 MB |
|
|
| |
Kajraare
| |
Kal Kissne Dekha
| |
|
01 - Kal Kissne Dekha (2009) - Aalam Guzrne Ko [www.DJLUV.in].mp3 |
9.38 MB |
|
| |
|
02 - Kal Kissne Dekha (2009) - Soniye Billori [www.DJLUV.in].mp3 |
11.21 MB |
|
| |
|
03 - Kal Kissne Dekha (2009) - Aasmaan Jhuk Gaya [www.DJLUV.in].mp3 |
9.92 MB |
|
| |
|
07 - Kal Kissne Dekha (2009) - Kal Kissne Dekha [www.DJLUV.in].mp3 |
10.67 MB |
|
| |
|
09 - Kal Kissne Dekha (2009) - Kal Kissne (Club Mix) [www.DJLUV.in].mp3 |
10.29 MB |
|
| |
|
10 - Kal Kissne Dekha (2009) - Kal Kissne Dekha (Romantic Version) [www.DJLUV.in].mp3 |
3.78 MB |
|
| |
|
Bin Tere Mar Javan Mein [www.DJLUV.in].mp3 |
3 MB |
|
| |
|
Jashn Hai Josh Hai [www.DJLUV.in].mp3 |
10.18 MB |
|
| |
|
Soniye Billori (Club Mix) [www.DJLUV.in].mp3 |
10.7 MB |
|
| |
|
Tere Bina Lagta Nahin [www.DJLUV.in].mp3 |
9.92 MB |
|
|
| |
|
[Songs.PK] Kajraare - 01 - Kajra Kajra Kajraare.mp3 |
4.98 MB |
|
| |
|
[Songs.PK] Kajraare - 02 - Rabba Luck Barsa.mp3 |
5.94 MB |
|
| |
|
[Songs.PK] Kajraare - 03 - Aafreen.mp3 |
8.13 MB |
|
| |
|
[Songs.PK] Kajraare - 04 - Tujhe Dekh Ke Armaan Jaage.mp3 |
5.95 MB |
|
| |
|
[Songs.PK] Kajraare - 05 - Teriyan Meriyan.mp3 |
6.19 MB |
|
| |
|
[Songs.PK] Kajraare - 06 - Woh Lamha Phir Se Jeena Hai.mp3 |
5.89 MB |
|
| |
|
[Songs.PK] Kajraare - 07 - Sanu Guzara Zamana.mp3 |
8.47 MB |
|
| |
|
[Songs.PK] Kajraare - 08 - Kajra Kajra Kajraare (Party Mix).mp3 |
4.24 MB |
|
| |
|
[Songs.PK] Kajraare - 09 - Rabba Luck Barsa (Party Mix).mp3 |
3.57 MB |
|
| |
|
[Songs.PK] Kajraare - 10 - Woh Lamha Phir Se Jeena Hai (Party Mix).mp3 |
5.06 MB |
|
| |
|
[Songs.PK] Kajraare - 11 - Sanu Guzara Zamana (Lounge Mix).mp3 |
6.36 MB |
|
|
| |
Kal Kissne Dekha
| |
|
01 - Kal Kissne Dekha (2009) - Aalam Guzrne Ko [www.DJLUV.in].mp3 |
9.38 MB |
|
| |
|
02 - Kal Kissne Dekha (2009) - Soniye Billori [www.DJLUV.in].mp3 |
11.21 MB |
|
| |
|
03 - Kal Kissne Dekha (2009) - Aasmaan Jhuk Gaya [www.DJLUV.in].mp3 |
9.92 MB |
|
| |
|
07 - Kal Kissne Dekha (2009) - Kal Kissne Dekha [www.DJLUV.in].mp3 |
10.67 MB |
|
| |
|
09 - Kal Kissne Dekha (2009) - Kal Kissne (Club Mix) [www.DJLUV.in].mp3 |
10.29 MB |
|
| |
|
10 - Kal Kissne Dekha (2009) - Kal Kissne Dekha (Romantic Version) [www.DJLUV.in].mp3 |
3.78 MB |
|
| |
|
Bin Tere Mar Javan Mein [www.DJLUV.in].mp3 |
3 MB |
|
| |
|
Jashn Hai Josh Hai [www.DJLUV.in].mp3 |
10.18 MB |
|
| |
|
Soniye Billori (Club Mix) [www.DJLUV.in].mp3 |
10.7 MB |
|
| |
|
Tere Bina Lagta Nahin [www.DJLUV.in].mp3 |
9.92 MB |
|
|
| |
Kamaal-Dhamaal-Malamaal-128Kbps-2012(Songs.PK)
| |
|
[Songs.PK] 01 - Dariya Ho.mp3 |
4.8 MB |
|
| |
|
[Songs.PK] 02 - Desi Mem.mp3 |
5.18 MB |
|
| |
|
[Songs.PK] 03 - Zor Naache.mp3 |
5.26 MB |
|
| |
|
[Songs.PK] 04 - Ishq Ki Dafli Baje.mp3 |
4.48 MB |
|
| |
|
[Songs.PK] 05 - Ringa Ringa.mp3 |
5.23 MB |
|
| |
|
[Songs.PK] 06 - Kamaal Dhamaal Malamaal (Theme).mp3 |
1.62 MB |
|
| |
|
[Songs.PK] 07 - Desi Mem (Remix).mp3 |
4.96 MB |
|
| |
|
[Songs.PK] 08 - Dariya Ho (Remix).mp3 |
4.31 MB |
|
| |
|
[Songs.PK] 09 - Ringa Ringa (Remix).mp3 |
4.46 MB |
|
|
| |
Kambakht ishq
| |
|
kambakht isq (1).mp3 |
2.13 MB |
|
| |
|
kambakht isq (2).mp3 |
2.67 MB |
|
| |
|
kambakht isq (3).mp3 |
2.15 MB |
|
| |
|
kambakht isq (4).mp3 |
2.56 MB |
|
| |
|
kambakht isq.mp3 |
2.37 MB |
|
|
| |
Karthik calling karthik
| |
|
kartik calling kartik (1).mp3 |
3.86 MB |
|
| |
|
kartik calling kartik (2).mp3 |
5.73 MB |
|
| |
|
kartik calling kartik (3).mp3 |
3.05 MB |
|
| |
|
kartik calling kartik (4).mp3 |
4.8 MB |
|
| |
|
kartik calling kartik.mp3 |
4.06 MB |
|
|
| |
Khatta-Meetha-128Kbps(Songs.PK)
| |
|
Aila Re Aila (Remix).mp3 |
4.37 MB |
|
| |
|
Aila Re Aila.mp3 |
5.16 MB |
|
| |
|
Bull Shit.mp3 |
4.59 MB |
|
| |
|
Khatta Meetha - 02 - Sajde.mp3 |
5.94 MB |
|
| |
|
Nana Chi Taang (Remix).mp3 |
4.87 MB |
|
| |
|
Nana Chi Taang.mp3 |
6.1 MB |
|
| |
|
Sajde (Remix).mp3 |
5.61 MB |
|
|
| |
Khelein-Hum-Jee-Jaan-Se
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 01 - Yeh Des Hai Mera.mp3 |
5.74 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 02 - Naiyn Tere.mp3 |
4.54 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 03 - Khelein Hum Jee Jaan Sey.mp3 |
5.63 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 04 - Sapne Saloney Hai Sach.mp3 |
5.7 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 05 - Vande Mataram (Revised Sanskrit To Hindi).mp3 |
4.65 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 06 - Long Live Chittagong.mp3 |
2.19 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 07 - The Teenagers Whistle.mp3 |
4.35 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 08 - Surjya's Sorrow.mp3 |
2.74 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 09 - Vande Mataram.mp3 |
2.08 MB |
|
| |
|
[Songs.PK] Khelein Hum Jee Jaan Sey - 10 - The Escape.mp3 |
2.77 MB |
|
| |
▼ And 1 file more
|
|
| |
Kissan
| |
|
Akash 1.mp3 |
2.13 MB |
|
| |
|
Akash 2.mp3 |
2.7 MB |
|
| |
|
Akash 3.mp3 |
1.38 MB |
|
|
| |
Kisse pyar karon
| |
|
Akash 1.mp3 |
2.48 MB |
|
| |
|
Akash 2.mp3 |
2.03 MB |
|
| |
|
Akash 3.mp3 |
2.55 MB |
|
|
| |
Kites
| |
|
01 Zindagi Do Pal Ki.mp3 |
4.06 MB |
|
| |
|
02 Dil Kyun Yeh Mera.mp3 |
5.27 MB |
|
| |
|
03 Tum Bhi Ho Wahi.mp3 |
3.76 MB |
|
| |
|
04 Kites In The Sky.mp3 |
5.37 MB |
|
| |
|
05 Fire.mp3 |
4.24 MB |
|
| |
|
06 Zindagi Do Pal Ki (Remix).mp3 |
3.62 MB |
|
| |
|
07 Dil Kyun Yeh Mera (Remix).mp3 |
4.41 MB |
|
| |
|
08 Tum Bhi Ho Wahi (Remix).mp3 |
3.38 MB |
|
| |
|
09 Fire (English Version).mp3 |
4.18 MB |
|
|
| |
Knock-Out-2010-128Kbps(Songs.PK)
| |
|
[Songs.PK] Knock Out - 01 - Knock Out.mp3 |
5.26 MB |
|
| |
|
[Songs.PK] Knock Out - 02 - Khushnuma Sa Ye Roshan Ho.mp3 |
6.09 MB |
|
| |
|
[Songs.PK] Knock Out - 03 - Jab Jab Dil Mile.mp3 |
4.79 MB |
|
| |
|
[Songs.PK] Knock Out - 04 - Tuhi Mere Hum Navaa.mp3 |
5.5 MB |
|
| |
|
[Songs.PK] Knock Out - 05 - Khushnuma Sa Woh Mausam.mp3 |
7.03 MB |
|
| |
|
[Songs.PK] Knock Out - 06 - Jab Jab Dil Mile (Remix).mp3 |
6.28 MB |
|
| |
|
[Songs.PK] Knock Out - 07 - Gangubai Pe Aai Jawani.mp3 |
5.91 MB |
|
|
| |
Krantiveer
| |
|
krantiveer01(www.songs.pk).mp3 |
6.42 MB |
|
| |
|
krantiveer02(www.songs.pk).mp3 |
5.24 MB |
|
| |
|
krantiveer03(www.songs.pk).mp3 |
4.44 MB |
|
| |
|
krantiveer04(www.songs.pk).mp3 |
6.1 MB |
|
|
| |
Kucch-Luv-Jaisaa-2011-320Kbps(Songs.PK)
| |
|
Baadlon Pe Paon.mp3 |
7.74 MB |
|
| |
|
Khwab (Raghav's Confession).mp3 |
10.3 MB |
|
| |
|
Khwab (Rock).mp3 |
8.4 MB |
|
| |
|
Naina.mp3 |
9.64 MB |
|
| |
|
Thoda Sa Pyaar (Madhu's Search For Love).mp3 |
9.48 MB |
|
| |
|
Thoda Sa Pyaar (Raghav's Search For Love).mp3 |
8.81 MB |
|
| |
|
Thoda Sa Pyaar.mp3 |
8.42 MB |
|
|
| |
Kurbaan
| |
|
kurban (1).mp3 |
5.2 MB |
|
| |
|
kurban (2).mp3 |
4.56 MB |
|
| |
|
kurban (3).mp3 |
2.95 MB |
|
| |
|
kurban (4).mp3 |
4.46 MB |
|
| |
|
kurban (5).mp3 |
4.38 MB |
|
| |
|
kurban.mp3 |
5.38 MB |
|
|
| |
Kushti
| |
|
kushti01(www.songs.pk).mp3 |
5.43 MB |
|
| |
|
kushti02(www.songs.pk).mp3 |
5.83 MB |
|
| |
|
kushti03(www.songs.pk).mp3 |
3.75 MB |
|
| |
|
kushti04(www.songs.pk).mp3 |
4.36 MB |
|
| |
|
kushti05(www.songs.pk).mp3 |
4.3 MB |
|
|
| |
Kya-Super-Kool-Hain-Hum-128Kbps-2012(Songs.PK)
| |
|
01 - Kya Super Kool Hain Hum - Dil Garden Garden Ho Gaya.mp3 |
4.01 MB |
|
| |
|
02 - Kya Super Kool Hain Hum - Shirt Da Button.mp3 |
8.08 MB |
|
| |
|
03 - Kya Super Kool Hain Hum - Hum Toh Hain Cappuccino (U.P. - Bihar Lootne).mp3 |
6.73 MB |
|
| |
|
04 - Kya Super Kool Hain Hum - Volume High Karle.mp3 |
4.36 MB |
|
| |
|
05 - Kya Super Kool Hain Hum - Shirt Da Button (Version 2).mp3 |
8.01 MB |
|
| |
|
06 - Kya Super Kool Hain Hum - Dil Garden Garden Ho Gaya (Remix).mp3 |
4.42 MB |
|
| |
|
07 - Kya Super Kool Hain Hum - Volume High Karle (Remix).mp3 |
4.71 MB |
|
| |
|
Kya Super Kool Hain Hum - Front.jpg |
37.35 KB |
|
|
| |
Ladies-VS-Ricky-Behl-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Ladies Vs Ricky Bahl - 01 - Aadat Se Majboor.mp3 |
5.5 MB |
|
| |
|
[Songs.PK] Ladies Vs Ricky Bahl - 02 - Jazba.mp3 |
5.47 MB |
|
| |
|
[Songs.PK] Ladies Vs Ricky Bahl - 03 - Thug Le.mp3 |
4.21 MB |
|
| |
|
[Songs.PK] Ladies Vs Ricky Bahl - 04 - Jigar Da Tukda.mp3 |
4.86 MB |
|
| |
|
[Songs.PK] Ladies Vs Ricky Bahl - 05 - Fatal Attraction.mp3 |
3.99 MB |
|
| |
|
[Songs.PK] Ladies Vs Ricky Bahl - 06 - Aadat Se Majboor (Remix).mp3 |
5.3 MB |
|
| |
|
[Songs.PK] Ladies Vs Ricky Bahl - 07 - Jazba (Remix).mp3 |
4.46 MB |
|
| |
|
Ladies Vs Ricky Bahl - Cover.jpg |
112.24 KB |
|
|
| |
Lafangey-Parindey
| |
|
[Songs.PK] Lafangey Parindey - 01 - Lafangey Parindey.mp3 |
5.71 MB |
|
| |
|
[Songs.PK] Lafangey Parindey - 02 - Man Lafanga.mp3 |
6.33 MB |
|
| |
|
[Songs.PK] Lafangey Parindey - 03 - Dhatad Tatad.mp3 |
4.41 MB |
|
| |
|
[Songs.PK] Lafangey Parindey - 05 - Rang Daalein.mp3 |
5.98 MB |
|
| |
|
[Songs.PK] Lafangey Parindey - 06 - Born To Fly.mp3 |
3.67 MB |
|
| |
|
[Songs.PK] Lafangey Parindey - 07 - Man Lafanga (Club Mix).mp3 |
4.16 MB |
|
| |
|
Nain Parindey.mp3 |
5.08 MB |
|
|
| |
Lamhaa
| |
|
[Songs.PK] Lamhaa - 01 - Madno.mp3 |
9.57 MB |
|
| |
|
[Songs.PK] Lamhaa - 02 - Salaam Zindagi.mp3 |
8.17 MB |
|
| |
|
[Songs.PK] Lamhaa - 03 - Main Kaun Hoon.mp3 |
8.47 MB |
|
| |
|
[Songs.PK] Lamhaa - 04 - Saajnaa.mp3 |
9.5 MB |
|
| |
|
[Songs.PK] Lamhaa - 05 - Zameen-O-Aasmaa.mp3 |
6.65 MB |
|
| |
|
[Songs.PK] Lamhaa - 06 - Rehmat Zara.mp3 |
6.4 MB |
|
|
| |
Lanka-2011-320Kbps(Songs.PK)
| |
|
[Songs.PK] Lanka - 01 - Iltija - Tumko Jo Dekhoon.mp3 |
6.38 MB |
|
| |
|
[Songs.PK] Lanka - 02 - Aap Ki Aahat.mp3 |
8.42 MB |
|
| |
|
[Songs.PK] Lanka - 03 - Sheet Leher.mp3 |
6.94 MB |
|
| |
|
[Songs.PK] Lanka - 04 - Barham Hai Hum.mp3 |
7.17 MB |
|
| |
|
[Songs.PK] Lanka - 05 - Tu Hai Tu (Qubool).mp3 |
9.53 MB |
|
| |
|
[Songs.PK] Lanka - 06 - Sheet Leher.mp3 |
6.84 MB |
|
| |
|
[Songs.PK] Lanka - 07 - Hai Rama Rama.mp3 |
5.74 MB |
|
| |
|
Lanka - Back Cover.jpg |
639.3 KB |
|
| |
|
Lanka - Front Cover.jpg |
622.66 KB |
|
|
| |
lifeexpress
| |
|
Banaras Ka Paan (Remix).mp3 |
4.57 MB |
|
| |
|
Banaras Ka Paan .mp3 |
4.95 MB |
|
| |
|
Jhule Jhule Palna .mp3 |
2.84 MB |
|
| |
|
Phool Khila De 1.mp3 |
4.54 MB |
|
| |
|
Phool Khila De.mp3 |
4.48 MB |
|
| |
|
Pyar Ka Namak.mp3 |
6.03 MB |
|
| |
|
Thori Si Kami .mp3 |
1.85 MB |
|
| |
|
Thori Si Kami.mp3 |
5.9 MB |
|
|
| |
Life Partner
| |
|
Akash 3.mp3 |
1.33 MB |
|
| |
|
Akash 4.mp3 |
588.51 KB |
|
| |
|
Akash 5.mp3 |
1.18 MB |
|
| |
|
Akash 6.mp3 |
1.29 MB |
|
| |
|
Akash 7.mp3 |
1.15 MB |
|
| |
|
kuke.mp3 |
1.14 MB |
|
| |
|
purza.mp3 |
1.22 MB |
|
|
| |
London-Paris-New-York-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] London Paris New York - 01 - London Paris New York.mp3 |
4.31 MB |
|
| |
|
[Songs.PK] London Paris New York - 02 - Voh Dekhnay Mein.mp3 |
5.13 MB |
|
| |
|
[Songs.PK] London Paris New York - 03 - Ting Rang.mp3 |
4.79 MB |
|
| |
|
[Songs.PK] London Paris New York - 04 - Thehree Si Zindagi.mp3 |
5.81 MB |
|
| |
|
[Songs.PK] London Paris New York - 05 - Oo Lala.mp3 |
5.32 MB |
|
| |
|
[Songs.PK] London Paris New York - 06 - Aaja.mp3 |
4.37 MB |
|
| |
|
[Songs.PK] London Paris New York - 07 - Voh Dekhnay mein (Female Acoustic Ver).mp3 |
1.56 MB |
|
| |
|
London Paris New York - Front Cover.jpg |
270.14 KB |
|
|
| |
London dreams
| |
|
london dream (1).mp3 |
2.27 MB |
|
| |
|
london dream (2).mp3 |
2.53 MB |
|
| |
|
london dream (3).mp3 |
2.65 MB |
|
| |
|
london dream (4).mp3 |
2.18 MB |
|
| |
|
london dream (5).mp3 |
2.2 MB |
|
| |
|
london dream.mp3 |
2.99 MB |
|
|
| |
Loot-128Kbps-2011(Songs.PK)
| |
|
[Songs.PK] Loot - 01 - Jawani Ki Bank Loot Le.mp3 |
5.59 MB |
|
| |
|
[Songs.PK] Loot - 02 - Loot Loot.mp3 |
6.01 MB |
|
| |
|
[Songs.PK] Loot - 03 - Saari Duniya Mere Ispe.mp3 |
5.13 MB |
|
| |
|
[Songs.PK] Loot - 04 - Ek Pata Ya Do Pata Ke.mp3 |
5.71 MB |
|
| |
|
[Songs.PK] Loot - 05 - Ajab Hulchal Si.mp3 |
6.34 MB |
|
| |
|
Loot - Back Cover.jpg |
175.59 KB |
|
| |
|
Loot - Front Cover.jpg |
209.87 KB |
|
|
| |
Love-Breakups-Zindagi-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Love Breakups Zindagi - 01 - Rozaana.mp3 |
4.23 MB |
|
| |
|
[Songs.PK] Love Breakups Zindagi - 02 - Rab Rakha.mp3 |
5.38 MB |
|
| |
|
[Songs.PK] Love Breakups Zindagi - 03 - Love Love Love.mp3 |
5.17 MB |
|
| |
|
[Songs.PK] Love Breakups Zindagi - 04 - Chhayee Hai Tanhayee.mp3 |
3.69 MB |
|
| |
|
[Songs.PK] Love Breakups Zindagi - 05 - Rozaana.mp3 |
4.79 MB |
|
| |
|
Love Breakups Zindagi - Back Cover.jpg |
404.26 KB |
|
| |
|
Love Breakups Zindagi - Front.jpg |
413.45 KB |
|
|
| |
Love-U-Mr-Kalakaar-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Love U Mr Kalakaar - 01 - Sarphira Sa Hai Dil.mp3 |
6.46 MB |
|
| |
|
[Songs.PK] Love U Mr Kalakaar - 02 - Tera Intezaar.mp3 |
4.98 MB |
|
| |
|
[Songs.PK] Love U Mr Kalakaar - 03 - Bhoore Bhoore Badal.mp3 |
5.08 MB |
|
| |
|
[Songs.PK] Love U Mr Kalakaar - 04 - Love U Mr.Kalakaar.mp3 |
4.47 MB |
|
| |
|
[Songs.PK] Love U Mr Kalakaar - 05 - Kahin Se Chali Aa.mp3 |
5.63 MB |
|
| |
|
[Songs.PK] Love U Mr Kalakaar - 06 - Tera Intezaar (Revisited).mp3 |
3.59 MB |
|
| |
|
[Songs.PK] Love U Mr Kalakaar - 07 - Reaching For The Rainbow.mp3 |
4.6 MB |
|
| |
|
Love U Mr Kalakaar - Back.jpg |
170.21 KB |
|
| |
|
Love U Mr Kalakaar - Front.jpg |
217.27 KB |
|
|
| |
Love aaj kal
| |
|
02 Ye Doorian.mp3 |
5.29 MB |
|
| |
|
love aaj kal (1).mp3 |
2.11 MB |
|
| |
|
love aaj kal (2).mp3 |
2.31 MB |
|
| |
|
love aaj kal (3).mp3 |
2 MB |
|
| |
|
love aaj kal (4).mp3 |
2.79 MB |
|
| |
|
love aaj kal.mp3 |
2.43 MB |
|
|
| |
Luck
| |
|
KHUDAYA VE .mp3 |
2.59 MB |
|
| |
|
luck (2).mp3 |
2.17 MB |
|
| |
|
luck (3).mp3 |
2.08 MB |
|
| |
|
luck (4).mp3 |
2.66 MB |
|
| |
|
luck.mp3 |
2.25 MB |
|
|
| |
Luv-Ka-The-End-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] - Luv Ka The End - 01 - Luv Ka The End.mp3 |
4.21 MB |
|
| |
|
[Songs.PK] - Luv Ka The End - 02 - Tonight.mp3 |
3.49 MB |
|
| |
|
[Songs.PK] - Luv Ka The End - 03 - Freak Out.mp3 |
3.56 MB |
|
| |
|
[Songs.PK] - Luv Ka The End - 04 - The Mutton Song.mp3 |
4.68 MB |
|
| |
|
[Songs.PK] - Luv Ka The End - 05 - F.U.N. Fun Funaa.mp3 |
4.96 MB |
|
| |
|
Luv Ka The End - Back Cover.jpg |
477.86 KB |
|
| |
|
Luv Ka The End - Front Cover.jpg |
189.87 KB |
|
|
| |
Mausam-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Mausam - 01 - Rabba Main Toh Mar Gaya Oye.mp3 |
5.53 MB |
|
| |
|
[Songs.PK] Mausam - 02 - Sajh Dhaj Ke.mp3 |
6.06 MB |
|
| |
|
[Songs.PK] Mausam - 03 - Ik Tu Hi Tu Hi.mp3 |
8.43 MB |
|
| |
|
[Songs.PK] Mausam - 04 - Poore Se Zara Sa Kam Hain.mp3 |
4.46 MB |
|
| |
|
[Songs.PK] Mausam - 05 - Aag Lage Us Aag Ko.mp3 |
3.75 MB |
|
| |
|
[Songs.PK] Mausam - 06 - Mallo Malli.mp3 |
4.68 MB |
|
| |
|
[Songs.PK] Mausam - 07 - Rabba Main Toh Mar Gaya Oye.mp3 |
5.12 MB |
|
| |
|
[Songs.PK] Mausam - 08 - Sajh Dhaj Ke (Desi Mix Tiger Style).mp3 |
6.05 MB |
|
| |
|
[Songs.PK] Mausam - 09 - Sajh Dhag Ke (Club Mix Tiger Style).mp3 |
5.65 MB |
|
| |
|
[Songs.PK] Mausam - 10 - Ik Tu Hi Tu Hi (Reprise).mp3 |
7.38 MB |
|
| |
▼ And 4 files more
|
|
| |
Maximum-128Kbps-2012(Songs.PK)
| |
|
[Songs.PK] 01 - Maximum - Aa Ante Amalapuram.mp3 |
5.58 MB |
|
| |
|
[Songs.PK] 02 - Maximum - Maan Qunto Maula.mp3 |
5.43 MB |
|
| |
|
[Songs.PK] 03 - Maximum - Aaja Meri Jaan.mp3 |
5.39 MB |
|
| |
|
[Songs.PK] 04 - Maximum - Sutta.mp3 |
5.28 MB |
|
| |
|
[Songs.PK] 05 - Maximum - Ya Maula.mp3 |
8.92 MB |
|
| |
|
[Songs.PK] 06 - Maximum - Namani Shamishaan.mp3 |
3.58 MB |
|
| |
|
Maximum - Back Cover.jpg |
567.68 KB |
|
| |
|
Maximum - Front Cover.jpg |
629.08 KB |
|
|
| |
Mere-Brother-Ki-Dulhan-2011
| |
|
[Songs.PK] Mere Brother Ki Dulhan - 01 - Mere Brother Ki Dulhan.mp3 |
4.82 MB |
|
| |
|
[Songs.PK] Mere Brother Ki Dulhan - 02 - Dhunki.mp3 |
4.58 MB |
|
| |
|
[Songs.PK] Mere Brother Ki Dulhan - 03 - Choomantar.mp3 |
4.68 MB |
|
| |
|
[Songs.PK] Mere Brother Ki Dulhan - 04 - Isq Risk.mp3 |
5.24 MB |
|
| |
|
[Songs.PK] Mere Brother Ki Dulhan - 05 - Madhubala.mp3 |
4.81 MB |
|
| |
|
[Songs.PK] Mere Brother Ki Dulhan - 06 - Do Dhaari Talwaar.mp3 |
5.17 MB |
|
| |
|
[Songs.PK] Mere Brother Ki Dulhan - 07 - Choomantar (Remix).mp3 |
4.51 MB |
|
| |
|
[Songs.PK] Mere Brother Ki Dulhan - 08 - Isq Risk (Risky Mix).mp3 |
5.35 MB |
|
|
| |
Mere Khawabon Mein Jo Aaye
| |
|
01 Pehle To Meri In Ankhon.mp3 |
4.23 MB |
|
| |
|
02 Sehmi Sehmi.mp3 |
4.44 MB |
|
| |
|
03 Kabhi Kabhi.mp3 |
3.92 MB |
|
| |
|
04 Kab Talak.mp3 |
3.39 MB |
|
| |
|
05 Patharon Ke Banne In Shahron.mp3 |
4.7 MB |
|
| |
|
06 Zindagi Mein Nayi Baat Hone Ko.mp3 |
3.91 MB |
|
| |
|
07 Sehmi Sehmi - Remix.mp3 |
3.92 MB |
|
| |
|
08 Instrumental.mp3 |
3.31 MB |
|
|
| |
Milenge-Milenge-128Kbps(Songs.PK)
| |
|
[Songs.PK] Milenge Milenge - 05 - Hare Kanch Ki Chuddiyan.mp3 |
7.78 MB |
|
| |
|
[Songs.PK] Milenge Milenge - 07 - Kuch Toh Baaki Hai (Remix).mp3 |
4.32 MB |
|
| |
|
[Songs.PK] Milenge Milenge - 08 - Ishq Ki Gali (Remix).mp3 |
4.11 MB |
|
| |
|
[Songs.PK] Milenge Milenge - 09 - Tum Chain Ho (Unplugged).mp3 |
4.48 MB |
|
| |
|
Ishq Ki Gali.mp3 |
6.39 MB |
|
| |
|
Kuch Toh Baaki Hai (Bright Mix).mp3 |
4.36 MB |
|
| |
|
Milenge Milenge - 01 - Kuch Toh Baaki Hai.mp3 |
4.3 MB |
|
| |
|
Milenge Milenge - 02 - Milenge Milenge.mp3 |
5.08 MB |
|
| |
|
Milenge Milenge.mp3 |
7.64 MB |
|
| |
|
Tum Chain Ho.mp3 |
4.69 MB |
|
|
| |
Miley-Naa-Miley-Hum-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Miley Naa Miley Hum - 01 - Haan Yahi Pyaar Hai.mp3 |
5.75 MB |
|
| |
|
[Songs.PK] Miley Naa Miley Hum - 02 - Wake Up Now.mp3 |
5.4 MB |
|
| |
|
[Songs.PK] Miley Naa Miley Hum - 03 - Katto Gilehri.mp3 |
5.65 MB |
|
| |
|
[Songs.PK] Miley Naa Miley Hum - 04 - Mahi Mahi.mp3 |
4.61 MB |
|
| |
|
[Songs.PK] Miley Naa Miley Hum - 05 - Nazar Je Nazar Mile (Rahat Version).mp3 |
6.25 MB |
|
| |
|
[Songs.PK] Miley Naa Miley Hum - 06 - Nazar Se Nazar Mile.mp3 |
6.61 MB |
|
| |
|
Copy of [Songs.PK] Miley Naa Miley Hum - 06 - Nazar Se Nazar Mile.mp3 |
6.61 MB |
|
| |
|
Miley Naa Miley Hum - Back.jpg |
234.61 KB |
|
| |
|
Miley Naa Miley Hum - Front.jpg |
242.7 KB |
|
|
| |
milkey ma milaey hum
| |
|
mileynaamileyhum01(www.songs.pk).mp3 |
5.75 MB |
|
| |
|
mileynaamileyhum02(www.songs.pk).mp3 |
5.4 MB |
|
| |
|
mileynaamileyhum03(www.songs.pk).mp3 |
5.65 MB |
|
| |
|
mileynaamileyhum04(www.songs.pk).mp3 |
4.61 MB |
|
| |
|
mileynaamileyhum05(www.songs.pk).mp3 |
6.25 MB |
|
| |
|
mileynaamileyhum06(www.songs.pk).mp3 |
6.61 MB |
|
|
| |
Mirch
| |
|
[Songs.PK] Mirch - 01 - Kaare Kaare Badra.mp3 |
6.68 MB |
|
| |
|
[Songs.PK] Mirch - 02 - Mann Bhi Hai.mp3 |
4.45 MB |
|
| |
|
[Songs.PK] Mirch - 03 - Zindagi Tu Hi Bata.mp3 |
4.8 MB |
|
| |
|
[Songs.PK] Mirch - 04 - Tikhi Tikhi Mirch (Western).mp3 |
3.51 MB |
|
| |
|
[Songs.PK] Mirch - 05 - Tikhi Tikhi Mirch (Folk Version).mp3 |
4.45 MB |
|
| |
|
[Songs.PK] Mirch - 06 - Mora Saiyyan.mp3 |
3.68 MB |
|
|
| |
Mr&mrs khaana
| |
|
MR AND MRS KHANNA (1).mp3 |
3.99 MB |
|
| |
|
MR AND MRS KHANNA (2).mp3 |
4.77 MB |
|
| |
|
MR AND MRS KHANNA (3).mp3 |
5.1 MB |
|
| |
|
MR AND MRS KHANNA (4).mp3 |
4.93 MB |
|
| |
|
MR AND MRS KHANNA.mp3 |
5.48 MB |
|
|
| |
MrSingh-MrsMehta-128Kbps(Songs.PK)
| |
|
A Shade Of Red.mp3 |
5.48 MB |
|
| |
|
Ai Khuda.mp3 |
8.22 MB |
|
| |
|
Ajnabi Ankhein.mp3 |
7.84 MB |
|
| |
|
Barhaan Dil Mein.mp3 |
5.6 MB |
|
| |
|
Barhaan Dil.mp3 |
5.72 MB |
|
| |
|
Behoshi Nasha Khushboo.mp3 |
10.03 MB |
|
| |
|
Fariyaad Hai.mp3 |
8.74 MB |
|
| |
|
Loser's Theme.mp3 |
3.28 MB |
|
| |
|
Nailpolish On The Toes.mp3 |
3.75 MB |
|
| |
|
Solitaire Blues.mp3 |
1.97 MB |
|
|
| |
mujhsay frndship karogay
| |
|
mujhsefraaandshipkaroge01(www.songs.pk).mp3 |
4.73 MB |
|
| |
|
mujhsefraaandshipkaroge02(www.songs.pk).mp3 |
3.97 MB |
|
| |
|
mujhsefraaandshipkaroge03(www.songs.pk).mp3 |
3.7 MB |
|
| |
|
mujhsefraaandshipkaroge04(www.songs.pk).mp3 |
4.72 MB |
|
| |
|
mujhsefraaandshipkaroge05(www.songs.pk).mp3 |
8.26 MB |
|
| |
|
mujhsefraaandshipkaroge06(www.songs.pk).mp3 |
6.77 MB |
|
| |
|
mujhsefraaandshipkaroge07(www.songs.pk).mp3 |
4.31 MB |
|
| |
|
mujhsefraaandshipkaroge08(www.songs.pk).mp3 |
5.01 MB |
|
|
| |
Mumbai-Mast-Kallander-128Kbps(Songs.PK)
| |
|
[Songs.PK] Mumbai Mast Kallander - 01 - Sloshed.mp3 |
5.27 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 02 - Mumbai Mast Kallander.mp3 |
5.41 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 03 - Ram Naam Bhaj Le.mp3 |
6.43 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 04 - Sunn Zara.mp3 |
6.87 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 05 - Mess It Up.mp3 |
6.06 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 06 - Mar Jana Soniye.mp3 |
4.64 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 07 - Mumbai Mast Kallander (Remix).mp3 |
4.87 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 08 - Sunn Zara (Remix).mp3 |
5.8 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 09 - Ram Naam Bhaj Le (Clubmix).mp3 |
3.97 MB |
|
| |
|
[Songs.PK] Mumbai Mast Kallander - 10 - Sunn Zara (Reprise Mix).mp3 |
4.19 MB |
|
| |
▼ And 1 file more
|
|
| |
Murder-2-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Murder 2 - 01 - Hale Dil.mp3 |
6.64 MB |
|
| |
|
[Songs.PK] Murder 2 - 02 - Aa Zara.mp3 |
5.63 MB |
|
| |
|
[Songs.PK] Murder 2 - 03 - Aye Khuda.mp3 |
7.96 MB |
|
| |
|
[Songs.PK] Murder 2 - 04 - Phir Mohabbat.mp3 |
6.54 MB |
|
| |
|
[Songs.PK] Murder 2 - 05 - Tujhko Bhulaana.mp3 |
4.38 MB |
|
| |
|
[Songs.PK] Murder 2 - 06 - Aa Zara (Reloaded).mp3 |
6.02 MB |
|
| |
|
[Songs.PK] Murder 2 - 07 - Hale Dil (Acoustic).mp3 |
5.79 MB |
|
| |
|
[Songs.PK] Murder 2 - 08 - Aye Khuda (Remix).mp3 |
4.24 MB |
|
|
| |
My name is Khan
| |
|
my name is khan (2).mp3 |
2.93 MB |
|
| |
|
my name is khan (3).mp3 |
1.86 MB |
|
| |
|
my name is khan (4).mp3 |
1.98 MB |
|
| |
|
my name is khan.mp3 |
3.16 MB |
|
| |
|
tere naina.mp3 |
2.26 MB |
|
|
| |
NewYork
| |
|
Copy of new yourk (3).mp3 |
2.68 MB |
|
| |
|
Copy of tu nai jo na kaha.....mp3 |
2.51 MB |
|
| |
|
new yourk (1).mp3 |
2.79 MB |
|
| |
|
new yourk (3).mp3 |
2.68 MB |
|
| |
|
new yourk.mp3 |
3.11 MB |
|
| |
|
tu nai jo na kaha.....mp3 |
2.51 MB |
|
|
| |
No-Problem-2010-128Kbps(Songs.PK)
| |
|
[Songs.PK] No Problem - 01 - No Problem.mp3 |
5.45 MB |
|
| |
|
[Songs.PK] No Problem - 02 - Shakira.mp3 |
4.9 MB |
|
| |
|
[Songs.PK] No Problem - 03 - Babe Di Kripa.mp3 |
4.93 MB |
|
| |
|
[Songs.PK] No Problem - 04 - We Are Innocent.mp3 |
5.52 MB |
|
| |
|
[Songs.PK] No Problem - 05 - Mast Punjabi.mp3 |
5.6 MB |
|
| |
|
[Songs.PK] No Problem - 06 - Babe Di Kripa (Remix).mp3 |
4.04 MB |
|
| |
|
[Songs.PK] No Problem - 07 - Shakira (Remix).mp3 |
5.19 MB |
|
| |
|
[Songs.PK] No Problem - 08 - Mast Punjabi (Remix).mp3 |
6.11 MB |
|
| |
|
No problem - Back Cover.jpg |
223.75 KB |
|
| |
|
No Problem - Front Cover.jpg |
199.26 KB |
|
|
| |
Once-Upon-A-Time-In-Mumbai
| |
|
Babu Rao.mp3 |
5.95 MB |
|
| |
|
I Am In Love (Dance).mp3 |
6.42 MB |
|
| |
|
I Am In Love 1.mp3 |
5.56 MB |
|
| |
|
I Am In Love.mp3 |
5.77 MB |
|
| |
|
Parda.mp3 |
6.04 MB |
|
| |
|
Pee Loon (Remix).mp3 |
4.57 MB |
|
| |
|
Pee Loon.mp3 |
5.7 MB |
|
| |
|
Tum Jo Aaye (Reprise).mp3 |
5.56 MB |
|
| |
|
Tum Jo Aaye.mp3 |
5.73 MB |
|
|
| |
Paa
| |
|
PAA (1).mp3 |
2.85 MB |
|
| |
|
PAA (2).mp3 |
2.53 MB |
|
| |
|
PAA (3).mp3 |
4.15 MB |
|
| |
|
PAA (4).mp3 |
2.58 MB |
|
| |
|
PAA (5).mp3 |
4.42 MB |
|
| |
|
PAA.mp3 |
4.06 MB |
|
|
| |
Paathshaala-128Kbps(Songs.PK)
| |
|
[Songs.PK] Paathshaala - 01 - Aye Khuda.mp3 |
5.43 MB |
|
| |
|
[Songs.PK] Paathshaala - 02 - Paathshaala (Khushnuma).mp3 |
4.15 MB |
|
| |
|
[Songs.PK] Paathshaala - 03 - Bekarar.mp3 |
5.12 MB |
|
| |
|
[Songs.PK] Paathshaala - 04 - Mujhe Teri.mp3 |
4.57 MB |
|
| |
|
[Songs.PK] Paathshaala - 05 - Teri Marzi (Aye Khuda).mp3 |
5.13 MB |
|
| |
|
[Songs.PK] Paathshaala - 06 - Aye Khuda (Remix).mp3 |
6.37 MB |
|
| |
|
[Songs.PK] Paathshaala - 07 - Teri Marzi Aye Khuda (Remix).mp3 |
4.74 MB |
|
| |
|
[Songs.PK] Paathshaala - 08 - Mujhe Teri (Remix).mp3 |
4.6 MB |
|
| |
|
[Songs.PK] Paathshaala - 09 - Bekarar (Remix).mp3 |
4.5 MB |
|
| |
|
[Songs.PK] Paathshaala - 10 - Paathshaala (Theme).mp3 |
2.52 MB |
|
|
| |
Patiala-House-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Patiala House - 01 - Laung Da Lashkara.mp3 |
5.66 MB |
|
| |
|
[Songs.PK] Patiala House - 02 - Kyun Main Jaagoon.mp3 |
6.14 MB |
|
| |
|
[Songs.PK] Patiala House - 03 - Rola Pe Gaya.mp3 |
5.16 MB |
|
| |
|
[Songs.PK] Patiala House - 04 - Aadat Hai Voh.mp3 |
4.79 MB |
|
| |
|
[Songs.PK] Patiala House - 05 - Baby When You Talk To Me.mp3 |
5.1 MB |
|
| |
|
[Songs.PK] Patiala House - 06 - Tumba Tumba.mp3 |
5.69 MB |
|
| |
|
[Songs.PK] Patiala House - 07 - Kyun Main Jaagoon (Unplugged).mp3 |
5.89 MB |
|
| |
|
[Songs.PK] Patiala House - 08 - Aval Allah.mp3 |
3.11 MB |
|
| |
|
[Songs.PK] Patiala House - 09 - Kyun Main Jaagoon (Remix).mp3 |
3.61 MB |
|
| |
|
[Songs.PK] Patiala House - 10 - Baby When You Talk To Me (Remix).mp3 |
5.48 MB |
|
| |
▼ And 1 file more
|
|
| |
Peepli-Live
| |
|
[Songs.PK] Peepli Live - 01 - Des Mera.mp3 |
6.19 MB |
|
| |
|
[Songs.PK] Peepli Live - 02 - Mehngai Dayain.mp3 |
3.94 MB |
|
| |
|
[Songs.PK] Peepli Live - 03 - Zindagi Se Darte Ho.mp3 |
8.27 MB |
|
| |
|
[Songs.PK] Peepli Live - 04 - Chola Maati Ke Ram.mp3 |
3.21 MB |
|
| |
|
[Songs.PK] Peepli Live - 05 - Des Mera II.mp3 |
5.78 MB |
|
| |
|
[Songs.PK] Peepli Live - 06 - Mehngai Dayain Remix.mp3 |
5.44 MB |
|
|
| |
Phas-Gaye-Re-Obama
| |
|
[Songs.PK] Phas Gaye Re Obama - 01 - Sara Pyaar Hai Bekaar.mp3 |
3.43 MB |
|
| |
|
[Songs.PK] Phas Gaye Re Obama - 02 - Amrikwa Ne Loot Liya.mp3 |
4.57 MB |
|
| |
|
[Songs.PK] Phas Gaye Re Obama - 03 - Sara Pyaar Hai Bekaar.mp3 |
3.45 MB |
|
| |
|
[Songs.PK] Phas Gaye Re Obama - 04 - Sara Pyaar Hai Bekaar (Remix).mp3 |
3.75 MB |
|
| |
|
[Songs.PK] Phas Gaye Re Obama - 05 - Returning Home.mp3 |
1.31 MB |
|
| |
|
[Songs.PK] Phas Gaye Re Obama - 06 - Welcome To The Gang.mp3 |
1.28 MB |
|
| |
|
[Songs.PK] Phas Gaye Re Obama - 07 - Yes We Can.mp3 |
1.83 MB |
|
| |
|
[Songs.PK] Phas Gaye Re Obama - 08 - American Meltdown.mp3 |
1.5 MB |
|
| |
|
[Songs.PK] Phas Gaye Re Obama - 09 - Run For Ransom.mp3 |
1.48 MB |
|
|
| |
Phhir
| |
|
[Songs.PK] Phhir - 01 - Yaadein.mp3 |
5.98 MB |
|
| |
|
[Songs.PK] Phhir - 02 - Satrangi Saathiya.mp3 |
4.85 MB |
|
| |
|
[Songs.PK] Phhir - 03 - Love Is All I Got.mp3 |
5.67 MB |
|
| |
|
[Songs.PK] Phhir - 04 - Karma Queen.mp3 |
5.63 MB |
|
| |
|
[Songs.PK] Phhir - 05 - Gumsum.mp3 |
5.05 MB |
|
| |
|
[Songs.PK] Phhir - 06 - Loot.mp3 |
5.05 MB |
|
| |
|
Phhir - Cover.jpg |
165.49 KB |
|
|
| |
Players-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Players - 01 - Jis Jagah Pe Khatam.mp3 |
4.86 MB |
|
| |
|
[Songs.PK] Players - 02 - Kyun Dooriyan (Jhoom Jhoom Ta Ja).mp3 |
6.01 MB |
|
| |
|
[Songs.PK] Players - 03 - Ho Gayi Tun.mp3 |
4.59 MB |
|
| |
|
[Songs.PK] Players - 04 - Buddhi Do Bhagwaan (Charlie's Song).mp3 |
5.86 MB |
|
| |
|
[Songs.PK] Players - 05 - Dil Ye Bekarar Kyun Hai.mp3 |
4.99 MB |
|
| |
|
[Songs.PK] Players - 06 - Kyun Dooriyan (Jhoom Jhoom Ta Hun Main).mp3 |
5.39 MB |
|
| |
|
[Songs.PK] Players - 07 - Dil Ye Bekarar Kyun Hai (Reprise).mp3 |
6.55 MB |
|
| |
|
[Songs.PK] Players - 08 - Jhoom Jhoom Ta Hun Main (Film Version).mp3 |
5.9 MB |
|
| |
|
[Songs.PK] Players - 09 - Jis Jagah Pe Khatam (Remix).mp3 |
4.16 MB |
|
| |
|
[Songs.PK] Players - 10 - Dil Ye Bekarar Kyun Hai (Remix).mp3 |
5.68 MB |
|
| |
|
Players - Front Cover.jpg |
181.96 KB |
|
|
| |
Prince
| |
|
o mere khuda.mp3 |
6.59 MB |
|
| |
|
PRINCE (1).mp3 |
4.02 MB |
|
| |
|
PRINCE (2).mp3 |
3.22 MB |
|
| |
|
PRINCE (3).mp3 |
3.76 MB |
|
| |
|
PRINCE (4).mp3 |
3.05 MB |
|
| |
|
PRINCE (5).mp3 |
4.18 MB |
|
| |
|
tere liye.mp3 |
4.15 MB |
|
|
| |
Pyaar-Ka-Punchnama-128Kbps-2011(Songs.PK)
| |
|
[Songs.PK] Pyaar Ka Punchnama - 01 - Life Sahi Hai.mp3 |
5.96 MB |
|
| |
|
[Songs.PK] Pyaar Ka Punchnama - 02 - Koi Aa Raha Paas Hai.mp3 |
5.27 MB |
|
| |
|
[Songs.PK] Pyaar Ka Punchnama - 03 - Kutta.mp3 |
4.79 MB |
|
| |
|
[Songs.PK] Pyaar Ka Punchnama - 04 - Chak Glassi.mp3 |
5.03 MB |
|
| |
|
[Songs.PK] Pyaar Ka Punchnama - 05 - Baanwre.mp3 |
7.73 MB |
|
| |
|
[Songs.PK] Pyaar Ka Punchnama - 06 - Ishq Na Kariyo Kakke.mp3 |
6.59 MB |
|
| |
|
[Songs.PK] Pyaar Ka Punchnama - 07 - Koi Aa Raha Paas Hai (Revisited).mp3 |
5.15 MB |
|
| |
|
[Songs.PK] Pyaar Ka Punchnama - 08 - Chak Glassi (Ad Boyz).mp3 |
5.05 MB |
|
| |
|
Pyaar Ka Punchnama - Front Cover.jpg |
405.43 KB |
|
|
| |
Pyaar impossible
| |
|
pyaar impossible (1).mp3 |
3.99 MB |
|
| |
|
pyaar impossible (2).mp3 |
4.72 MB |
|
| |
|
pyaar impossible (3).mp3 |
4.34 MB |
|
| |
|
pyaar impossible (4).mp3 |
3.7 MB |
|
| |
|
pyaar impossible.mp3 |
3.44 MB |
|
|
| |
Raavan
| |
Ra.One-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Ra.One - 01 - Chammak Challo.mp3 |
4.38 MB |
|
| |
|
[Songs.PK] Ra.One - 02 - Dildaara (Stand By Me).mp3 |
4.85 MB |
|
| |
|
[Songs.PK] Ra.One - 03 - Criminal.mp3 |
6.09 MB |
|
| |
|
[Songs.PK] Ra.One - 04 - Bhare Naina.mp3 |
6.81 MB |
|
| |
|
[Songs.PK] Ra.One - 05 - Right By Your Side.mp3 |
5.29 MB |
|
| |
|
[Songs.PK] Ra.One - 06 - Raftaarein.mp3 |
5.46 MB |
|
| |
|
[Songs.PK] Ra.One - 07 - Jiya Mora Ghabraaye (The Chase).mp3 |
5.46 MB |
|
| |
|
[Songs.PK] Ra.One - 08 - Chammak Challo (Remix Abhijit Vaghani).mp3 |
4.81 MB |
|
| |
|
[Songs.PK] Ra.One - 09 - Comes The Light (Theme).mp3 |
1.91 MB |
|
| |
|
[Songs.PK] Ra.One - 10 - I'm On (Theme).mp3 |
1.66 MB |
|
| |
▼ And 4 files more
|
|
| |
|
Beera.mp3 |
3.91 MB |
|
| |
|
Behene De.mp3 |
7.26 MB |
|
| |
|
Kata Kata.mp3 |
6.57 MB |
|
| |
|
Khili Re.mp3 |
4.86 MB |
|
| |
|
Ranjha Ranjha.mp3 |
7.14 MB |
|
| |
|
Thok Di Killi.mp3 |
6.02 MB |
|
|
| |
Raaz-3-128Kbps-2012(Songs.PK)
| |
|
[Songs.PK] Raaz 3 - 01 - Deewana Kar Raha Hai.mp3 |
6.75 MB |
|
| |
|
[Songs.PK] Raaz 3 - 02 - Zindagi Se.mp3 |
5.42 MB |
|
| |
|
[Songs.PK] Raaz 3 - 03 - Rafta Rafta.mp3 |
5.6 MB |
|
| |
|
[Songs.PK] Raaz 3 - 04 - Oh My God.mp3 |
5.64 MB |
|
| |
|
[Songs.PK] Raaz 3 - 05 - Kya Raaz Hai.mp3 |
4.33 MB |
|
| |
|
[Songs.PK] Raaz 3 - 06 - Khayalon Mein.mp3 |
5.1 MB |
|
| |
|
Raaz 3 - Back Cover.jpg |
630.81 KB |
|
| |
|
Raaz 3 - Front Cover.jpg |
709 KB |
|
|
| |
Raaz - The Mystery Continues
| |
|
04 - Kaisa Yeh Raaz Hai - K.K. by Amit Garg.mp3 |
8.3 MB |
|
| |
|
05 - O Banda Re - Krishna by Amit Garg.mp3 |
5.38 MB |
|
| |
|
06 - Soniyo (From the heart) by Amit Garg.mp3 |
7.93 MB |
|
| |
|
07 - Maahi (Rock with me) by Amit Garg.mp3 |
6.73 MB |
|
| |
|
Maahi - Toshi by Amit Garg.mp3 |
6.5 MB |
|
| |
|
O Jaana (Dance with me mix) by Amit Garg.mp3 |
5.83 MB |
|
| |
|
O Jaana - K.K. by Amit Garg.mp3 |
6.52 MB |
|
| |
|
Soniye - Sonu Nigam and Shreya Ghoshal by Amit Garg.mp3 |
7.62 MB |
|
|
| |
Rab ne bana de jodi
| |
|
hum hai rahi pyar ke.mp3 |
3.16 MB |
|
|
| |
Radio
| |
|
radio (1).mp3 |
4.53 MB |
|
| |
|
radio (2).mp3 |
5.24 MB |
|
| |
|
radio (3).mp3 |
4.12 MB |
|
| |
|
radio (4).mp3 |
3.87 MB |
|
| |
|
radio.mp3 |
4.14 MB |
|
|
| |
Raeth-Hum-Yaadon-Ke-Sang
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 01 - Hum Yaadon Ke Sang.mp3 |
5.92 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 02 - Waada.mp3 |
6.83 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 03 - Mein Chala.mp3 |
4.16 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 04 - Tum Meri Ho.mp3 |
5.13 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 05 - Bolo Toh.mp3 |
5.31 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 06 - Jhoothi Kahani.mp3 |
4.96 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 07 - Aag.mp3 |
5.98 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 08 - Dil Nahin Manta.mp3 |
4.19 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 09 - Hum Yaadon Ke Sang (Acoustic).mp3 |
5.73 MB |
|
| |
|
[Songs.PK] Raeth Hum Yaadon Ke Sang - 10 - Hum Yaadon Ke Sang (Club Mix).mp3 |
7.4 MB |
|
|
| |
Rajneeti
| |
|
bheegi si bhag sai.mp3 |
5.61 MB |
|
| |
|
dhan dhan dharti reprise.mp3 |
4.9 MB |
|
| |
|
dhan dhan dharti.mp3 |
4.92 MB |
|
| |
|
ishq barse 1.mp3 |
5.13 MB |
|
| |
|
ishq barse.mp3 |
4.74 MB |
|
| |
|
mora piya remix.mp3 |
4.96 MB |
|
| |
|
mora piya.mp3 |
6.53 MB |
|
| |
|
more piya mo se bolat.mp3 |
4.63 MB |
|
|
| |
Rascals
| |
|
[Songs.PK] Rascals - 01 - Tik Tuk.mp3 |
4.93 MB |
|
| |
|
[Songs.PK] Rascals - 03 - Pardaah Nasheen.mp3 |
5.46 MB |
|
| |
|
[Songs.PK] Rascals - 04 - Rascals.mp3 |
5.45 MB |
|
| |
|
[Songs.PK] Rascals - 06 - Rascals (Dance Mix).mp3 |
5.99 MB |
|
| |
|
Rascals - Back Cover.jpg |
239.68 KB |
|
| |
|
Rascals - Front Cover.jpg |
234.34 KB |
|
| |
|
Shake It Saiyyan (Hip-Hop Mix).mp3 |
4.18 MB |
|
| |
|
Shake It Saiyyan.mp3 |
4.95 MB |
|
|
| |
Ready-2011-128Kbps(Songs.PK)
| |
|
Character Dheela (Ishq Ke Naam).mp3 |
4.54 MB |
|
| |
|
Character Dheela (Remix) (Ishq Ke Naam Remix).mp3 |
3.77 MB |
|
| |
|
Dhinka Chika (Remix).mp3 |
5.73 MB |
|
| |
|
Dhinka Chika.mp3 |
5.81 MB |
|
| |
|
Humko Pyar Hua (Chal Chale).mp3 |
6.82 MB |
|
| |
|
Humko Pyar Hua (Remix) (Chal Chale Remix).mp3 |
5.4 MB |
|
| |
|
Meri Ada Bhi (Ishq Ne Mere).mp3 |
4.9 MB |
|
| |
|
Meri Ada Bhi (Remix) (Ishq Ne Mere Remix).mp3 |
4.33 MB |
|
|
| |
Rock-And-Dhol-Bombay-Rockers-2011
| |
|
[Songs.PK] Rock And Dhol - 01 - Hit The Dhol.mp3 |
2.28 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 02 - Let's Dance.mp3 |
6.06 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 03 - Ishq.mp3 |
5.71 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 04 - Aaja.mp3 |
6.34 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 05 - Thewa.mp3 |
6.44 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 06 - Yeh Hi Hai Wo.mp3 |
7.29 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 07 - Rock And Dhol.mp3 |
5.66 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 08 - Electro Blues.mp3 |
5.8 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 09 - Nava Nava.mp3 |
5.85 MB |
|
| |
|
[Songs.PK] Rock And Dhol - 10 - Nasha.mp3 |
7.23 MB |
|
| |
▼ And 1 file more
|
|
| |
Rock on
| |
|
01 ~ Socha Hai.mp3 |
3.97 MB |
|
| |
|
02 ~ Pichle Saat Dinon Mein.mp3 |
3.07 MB |
|
| |
|
03 ~ Rock On.mp3 |
3.72 MB |
|
| |
|
04 ~ Ye Tumhari Meri Baatein.mp3 |
5.15 MB |
|
| |
|
05 ~ Zehreelay.mp3 |
3.52 MB |
|
| |
|
06 ~ Tum Ho Toh.mp3 |
4.03 MB |
|
| |
|
07 ~ Sinbad The Sailor.mp3 |
6.12 MB |
|
| |
|
08 ~ Pichle Saat Dinon Mein.mp3 |
6.17 MB |
|
| |
|
09 ~ Phir Dekhiye.mp3 |
3.3 MB |
|
|
| |
Rockstar
| |
|
Aur Ho - www.Songs.PK).mp3 |
5.99 MB |
|
| |
|
Hawaa Hawaa - www.Songs.PK.mp3 |
6.99 MB |
|
| |
|
Jo Bhi Main - www.Songs.PK.mp3 |
5.04 MB |
|
| |
|
Kun Faya Kun - www.Songs.PK.mp3 |
9.18 MB |
|
| |
|
Meeting Place - www.Songs.PK.mp3 |
1.24 MB |
|
| |
|
Nadaan Parinde - www.Songs.PK.mp3 |
7.05 MB |
|
| |
|
Phir Se Ud Chala - www.Songs.PK.mp3 |
5.12 MB |
|
| |
|
rockstar05(www.songs.pk).mp3 |
4.76 MB |
|
| |
|
Saadda Haq - www.Songs.PK.mp3 |
6.78 MB |
|
| |
|
Tango For Taj - www.Songs.PK.mp3 |
3.55 MB |
|
| |
▼ And 2 files more
|
|
| |
Rowdy-Rathore-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Rowdy Rathore - 01 - Dhadhang Dhang.mp3 |
5.78 MB |
|
| |
|
[Songs.PK] Rowdy Rathore - 02 - Chinta Ta Ta Chita Chita.mp3 |
5.31 MB |
|
| |
|
[Songs.PK] Rowdy Rathore - 03 - Aa Re Pritam Pyaare.mp3 |
5.31 MB |
|
| |
|
[Songs.PK] Rowdy Rathore - 04 - Chamak Challo Chel Chabeli.mp3 |
6.31 MB |
|
| |
|
[Songs.PK] Rowdy Rathore - 05 - Tera Ishq Bada Teekha.mp3 |
5.19 MB |
|
| |
|
[Songs.PK] Rowdy Rathore - 06 - Chandaniya (Lori Lori).mp3 |
4.55 MB |
|
| |
|
[Songs.PK] Rowdy Rathore - 07 - Rowdy Mix.mp3 |
4.95 MB |
|
|
| |
Runway
| |
|
Khuda Ke Liye (Remix).mp3 |
10.89 MB |
|
| |
|
Khuda Ke Liye.mp3 |
11.27 MB |
|
| |
|
Pyaasi Machuriya.mp3 |
11.49 MB |
|
| |
|
Roshan Dil Ka Jahan (Dance Mix).mp3 |
12.23 MB |
|
| |
|
Roshan Dil Ka Jahan.mp3 |
13.1 MB |
|
| |
|
Teri Yaadein (Remix).mp3 |
12.89 MB |
|
| |
|
Teri Yaadein Leke Dil Mein.mp3 |
12.12 MB |
|
|
| |
Sadiyaan-128Kbps(Songs.PK)
| |
|
[Songs.PK] Sadiyaan - 01 - Jadu Nasha Ehsas Kya.mp3 |
8.14 MB |
|
| |
|
[Songs.PK] Sadiyaan - 02 - Taron Bhari Hai Ye Raat Sajan.mp3 |
8.56 MB |
|
| |
|
[Songs.PK] Sadiyaan - 03 - Sargoshiyo Ke Kya Silsile Hai.mp3 |
6.74 MB |
|
| |
|
[Songs.PK] Sadiyaan - 04 - Dekha Tujhay Jo Pehli Baar.mp3 |
7.2 MB |
|
| |
|
[Songs.PK] Sadiyaan - 05 - Man Mouji Matwala Man Mora.mp3 |
5.51 MB |
|
| |
|
[Songs.PK] Sadiyaan - 06 - Sona Lagdha Mahi Sona Lagdha.mp3 |
8.82 MB |
|
| |
|
[Songs.PK] Sadiyaan - 07 - Pehla Pehla Tejurba Hai.mp3 |
5.84 MB |
|
| |
|
[Songs.PK] Sadiyaan - 08 - Waqt Ne Jo Bij Boyaa.mp3 |
10.42 MB |
|
|
| |
Shaapit
| |
|
06 Hayaati Ye Hayaati Kehati.mp3 |
4.5 MB |
|
| |
|
Ajnabi Hawaayein Bekrara Bahein.mp3 |
4.46 MB |
|
| |
|
Chaahata Dil Tumko Tum Nahin Janate.mp3 |
4.44 MB |
|
| |
|
Kabhi Na Kabhi To Miloge (Rock).mp3 |
4.75 MB |
|
| |
|
Kabhi Na Kabhi To Miloge.mp3 |
5.92 MB |
|
| |
|
Shaapit Hua Kya Kya Hota Hain.mp3 |
3.33 MB |
|
| |
|
Tere Bina Jiya Na Jaye.mp3 |
4.57 MB |
|
|
| |
Shahrukh-Bola-Khoosurat-Hai-Tu
| |
|
[Songs.PK] Shahrukh Bola Khoobsurat Hai Tu - 01 - Shahrukh Bola Khoobsurat Hai Tu.mp3 |
4.18 MB |
|
| |
|
[Songs.PK] Shahrukh Bola Khoobsurat Hai Tu - 03 - Bhool Jaana II.mp3 |
6.95 MB |
|
| |
|
[Songs.PK] Shahrukh Bola Khoobsurat Hai Tu - 05 - Hasna Hasana.mp3 |
3.5 MB |
|
| |
|
[Songs.PK] Shahrukh Bola Khoobsurat Hai Tu - 06 - Socha Na Tha.mp3 |
7.68 MB |
|
| |
|
Shahrukh Bola Khoobsurat Hai Tu - 02 - Bhool Jaana.mp3 |
6.75 MB |
|
| |
|
Shahrukh Bola Khoobsurat Hai Tu - 04 - Batiyan.mp3 |
4.59 MB |
|
|
| |
Shaitan-128Kbps-2011(Songs.PK)
| |
|
Amy's Theme.mp3 |
3.82 MB |
|
| |
|
Bali (The Sound Of Shaitan).mp3 |
4.42 MB |
|
| |
|
Enter (Music).mp3 |
1.77 MB |
|
| |
|
Fareeda.mp3 |
4.02 MB |
|
| |
|
Josh.mp3 |
4.68 MB |
|
| |
|
Nasha (Rock & Soul Version).mp3 |
4.88 MB |
|
| |
|
Nasha.mp3 |
3.7 MB |
|
| |
|
O Yaara.mp3 |
6.02 MB |
|
| |
|
Outro (Music).mp3 |
1.75 MB |
|
| |
|
Pintya.mp3 |
3.38 MB |
|
| |
▼ And 2 files more
|
|
| |
Shanghai-2012-320Kbps(Songs.PK)
| |
|
[Songs.PK] Shanghai - 01 - Bharat Mata Ki Jai.mp3 |
9.01 MB |
|
| |
|
[Songs.PK] Shanghai - 02 - Imported Kamariya.mp3 |
5.1 MB |
|
| |
|
[Songs.PK] Shanghai - 03 - Duaa.mp3 |
7.67 MB |
|
| |
|
[Songs.PK] Shanghai - 04 - Khudaaya.mp3 |
3.66 MB |
|
| |
|
[Songs.PK] Shanghai - 05 - Morcha.mp3 |
4.59 MB |
|
| |
|
[Songs.PK] Shanghai - 06 - Bharat Mata Ki Jai (Remix).mp3 |
6.68 MB |
|
| |
|
[Songs.PK] Shanghai - 07 - Khudaaya (Remix).mp3 |
6.48 MB |
|
| |
|
[Songs.PK] Shanghai - 08 - Mantra Vishnu Sahasranamam (The Thousand Names Of Lord Vishnu).mp3 |
8.35 MB |
|
| |
|
Shanghai - Front Cover.jpg |
350.6 KB |
|
|
| |
Shirin-Farhad-Ki-Toh-Nikal-Padi-128Kbps(Songs.PK)(1)
| |
|
[Songs.PK 01 - Ishq Mein Tere Bina.mp3 |
5.42 MB |
|
| |
|
[Songs.PK 02 - Khatti Meethi.mp3 |
6.12 MB |
|
| |
|
[Songs.PK 03 - Kaafir Andhere.mp3 |
5.13 MB |
|
| |
|
[Songs.PK 04 - Shirin Farhad Ki Toh Nikal Padi 1.mp3 |
4.54 MB |
|
| |
|
[Songs.PK 05 - Kukuduku.mp3 |
5.26 MB |
|
| |
|
[Songs.PK 06 - Ramba Mein Samba.mp3 |
5.82 MB |
|
|
| |
Shor-In-The-City-2011-128Kbps(Songs.PK)
| |
|
Babam bam.mp3 |
6.37 MB |
|
| |
|
Deem Deem Tana.mp3 |
3.44 MB |
|
| |
|
Karma Is A Bitch.mp3 |
4.1 MB |
|
| |
|
Saibo Remix.mp3 |
4.09 MB |
|
| |
|
Saibo.mp3 |
3.89 MB |
|
| |
|
Shor.mp3 |
4.96 MB |
|
| |
|
Teri Justajoo (Saaware).mp3 |
5.1 MB |
|
| |
|
Ujale Baaz.mp3 |
4.71 MB |
|
|
| |
Singham-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Singham - 01 - Singham.mp3 |
7.3 MB |
|
| |
|
[Songs.PK] Singham - 02 - Saathiyaa.mp3 |
6.01 MB |
|
| |
|
[Songs.PK] Singham - 03 - Maula Maula.mp3 |
4.94 MB |
|
| |
|
[Songs.PK] Singham - 04 - Singham (Remix).mp3 |
4.19 MB |
|
| |
|
[Songs.PK] Singham - 05 - Saathiyaa (Remix).mp3 |
5.96 MB |
|
| |
|
[Songs.PK] Singham - 06 - Maula Maula (Remix).mp3 |
4.66 MB |
|
| |
|
Singham - Front Cover.jpg |
213.83 KB |
|
|
| |
slumdog
| |
|
01 ~ O Saya.mp3 |
3.43 MB |
|
| |
|
02 ~ Riots.mp3 |
1.99 MB |
|
| |
|
04 ~ Paper Planes.mp3 |
3.27 MB |
|
| |
|
05 ~ Paper Planes [DFA Remix].mp3 |
5.5 MB |
|
| |
|
07 ~ Liquid Dance.mp3 |
2.9 MB |
|
| |
|
Jai ho.mp3 |
3.02 MB |
|
| |
|
Ringa Ringa.mp3 |
4.06 MB |
|
|
| |
Soch-Lo
| |
|
[Songs.PK] Soch Lo - 01 - Dedh Inch Oopar (Honeymoon).mp3 |
2.69 MB |
|
| |
|
[Songs.PK] Soch Lo - 02 - Dedh Inch Oopar.mp3 |
5.87 MB |
|
| |
|
[Songs.PK] Soch Lo - 03 - Faani Dayar.mp3 |
6.8 MB |
|
| |
|
[Songs.PK] Soch Lo - 04 - Kasera.mp3 |
7.02 MB |
|
| |
|
[Songs.PK] Soch Lo - 06 - Mera Yahaan Hai Kaun (Female).mp3 |
4.82 MB |
|
| |
|
[Songs.PK] Soch Lo - 06 - Mera Yahaan Hai Kaun.mp3 |
5.14 MB |
|
| |
|
[Songs.PK] Soch Lo - 07 - Save Me Destiny.mp3 |
4.28 MB |
|
| |
|
[Songs.PK] Soch Lo - 08 - Soch Lo Theme.mp3 |
4.85 MB |
|
|
| |
Sorry BHai
| |
|
Akash 4.mp3 |
1.45 MB |
|
| |
|
Akash 5.mp3 |
1.18 MB |
|
|
| |
Sukoon-Vaishali-Made-320Kbps-2012(Songs.PK)
| |
|
[Songs.PK] 01 - Ya Maula Chain Le Ya Mera Le Sukoon.mp3 |
9.81 MB |
|
| |
|
[Songs.PK] 02 - Ishq Ho Ya Khuda Kab Mile Kya Pata.mp3 |
8.71 MB |
|
| |
|
[Songs.PK] 03 - Lamhe Mahakne Lage Hain.mp3 |
7.8 MB |
|
| |
|
[Songs.PK] 04 - Hum Teri Khusboo Mein Doobe Sara Din Rahe.mp3 |
6.07 MB |
|
| |
|
[Songs.PK] 05 - Lagi Haton Mein Mehandi.mp3 |
8.76 MB |
|
| |
|
[Songs.PK] 06 - Ya Maula Chain Le Ya Mera Le Sukoon (Remix).mp3 |
9.46 MB |
|
| |
|
Sukoon - Vaishali Made - Cover.jpg |
33.41 KB |
|
|
| |
Tanu-Weds-Manu-2011-128Kbps(Songs.PK)t
| |
|
- Sadi Gali.mp3 |
5.09 MB |
|
| |
|
Jugni.mp3 |
3.88 MB |
|
| |
|
Manu Bhaiya.mp3 |
6.1 MB |
|
| |
|
Piya.mp3 |
7.1 MB |
|
| |
|
Rangrez (wadali bros).mp3 |
7.78 MB |
|
| |
|
Rangrez.mp3 |
7.85 MB |
|
| |
|
Yun Hi.mp3 |
5.45 MB |
|
|
| |
Tees-Maar-Khan
| |
|
Badey Dilwala(Remix).mp3 |
5.48 MB |
|
| |
|
Badey Dilwala.mp3 |
5.91 MB |
|
| |
|
Happy Ending.mp3 |
5.55 MB |
|
| |
|
Sheila Ki Jawani (Remix).mp3 |
5.6 MB |
|
| |
|
Sheila Ki Jawani.mp3 |
5.67 MB |
|
| |
|
Tees Maar Khan (Remix).mp3 |
5.03 MB |
|
| |
|
Tees Maar Khan.mp3 |
5.23 MB |
|
| |
|
Wallah Re Wallah (Remix).mp3 |
5.55 MB |
|
| |
|
Wallah Re Wallah.mp3 |
6.59 MB |
|
|
| |
Tell-Me-O-Khuda-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] Tell Me O Kkhuda - 01 - Someone Somebody.mp3 |
6.79 MB |
|
| |
|
[Songs.PK] Tell Me O Kkhuda - 02 - Mera Man Jabse Racha Hai Sawariya.mp3 |
6.04 MB |
|
| |
|
[Songs.PK] Tell Me O Kkhuda - 03 - Mile Na Tu.mp3 |
4.03 MB |
|
| |
|
[Songs.PK] Tell Me O Kkhuda - 04 - Nagma Koi Gunguna Ne Ka.mp3 |
5.72 MB |
|
| |
|
[Songs.PK] Tell Me O Kkhuda - 05 - Love You Dad.mp3 |
4.82 MB |
|
| |
|
[Songs.PK] Tell Me O Kkhuda - 06 - Someone Somebody (Remix).mp3 |
6.29 MB |
|
| |
|
[Songs.PK] Tell Me O Kkhuda - 07 - Tell Me O Kkhuda.mp3 |
5.38 MB |
|
| |
|
Tell Me O Kkhuda - Back.jpg |
642.95 KB |
|
| |
|
Tell Me O Kkhuda - Front.jpg |
485.62 KB |
|
|
| |
Tera-Kya-Hoga-Johny
| |
|
[Songs.PK] 01 - Tera Kya Hoga Johny - Tera Kya Hoga Johny.mp3 |
4.09 MB |
|
| |
|
[Songs.PK] 02 - Teri Parchhaiyan - Tera Kya Hoga Johny.mp3 |
6.15 MB |
|
| |
|
[Songs.PK] 03 - Shab Ko Roz - Tera Kya Hoga Johny.mp3 |
4.53 MB |
|
| |
|
[Songs.PK] 04 - Heeriye - Tera Kya Hoga Johny.mp3 |
4.21 MB |
|
| |
|
[Songs.PK] 05 - Tore Naina - Tera Kya Hoga Johny.mp3 |
8.2 MB |
|
| |
|
[Songs.PK] 06 - Lehron Ne Kaha - Tera Kya Hoga Johny.mp3 |
4.97 MB |
|
| |
|
[Songs.PK] 07 - Shehar Ki Rani - Tera Kya Hoga Johny.mp3 |
4.86 MB |
|
|
| |
Tere-Bin-Laden
| |
|
[Songs.PK] 01 - Tere Bin Laden - Ullu Da Pattha.mp3 |
4.66 MB |
|
| |
|
[Songs.PK] 02 - Tere Bin Laden - Shor Sharaba.mp3 |
4.49 MB |
|
| |
|
[Songs.PK] 03 - Tere Bin Laden - I Love Amreeka.mp3 |
3.73 MB |
|
| |
|
[Songs.PK] 04 - Tere Bin Laden - Kukduk.mp3 |
4.51 MB |
|
| |
|
[Songs.PK] 05 - Tere Bin Laden - Welcome To Amreeka.mp3 |
3.05 MB |
|
| |
|
[Songs.PK] 06 - Tere Bin Laden - Bus Ek Soch.mp3 |
5.25 MB |
|
| |
|
[Songs.PK] 07 - Tere Bin Laden - Ullu Da Pattha (Remix).mp3 |
3.88 MB |
|
| |
|
[Songs.PK] 08 - Tere Bin Laden - I Love Amreeka (Reprise).mp3 |
3.76 MB |
|
|
| |
Tere-Naal-Love-Ho-Gaya-2012-128Kbps(Songs.PK)
| |
|
- Fann Ban Gayi Remix (Remix by VIP Records, UK).mp3 |
3.75 MB |
|
| |
|
Fann Ban Gayi.mp3 |
4.39 MB |
|
| |
|
Jeene De (Coffee House Version).mp3 |
4.91 MB |
|
| |
|
Jeene De.mp3 |
6.13 MB |
|
| |
|
Pee Pa Desi Mix (Remix by VIP Records, UK).mp3 |
3.85 MB |
|
| |
|
Pee Pa Pee Pa Ho Gaya.mp3 |
4.65 MB |
|
| |
|
Piya (Remix by DJ Suketu).mp3 |
3.64 MB |
|
| |
|
Piya O Re Piya (Sad).mp3 |
2.98 MB |
|
| |
|
Piya O Re Piya.mp3 |
5.56 MB |
|
| |
|
Tu Mohabbat Hai (Remix by DJ Suketu).mp3 |
7.77 MB |
|
| |
|
Tu Mohabbat Hai.mp3 |
6.42 MB |
|
|
| |
Tere sang
| |
|
tere sang (1).mp3 |
1.46 MB |
|
| |
|
tere sang (2).mp3 |
1.27 MB |
|
| |
|
tere sang (3).mp3 |
1.15 MB |
|
| |
|
tere sang (4).mp3 |
1.27 MB |
|
| |
|
tere sang (5).mp3 |
827.39 KB |
|
| |
|
tere sang (6).mp3 |
1.24 MB |
|
| |
|
tere sang (7).mp3 |
1.36 MB |
|
| |
|
tere sang (8).mp3 |
1.33 MB |
|
| |
|
tere sang.mp3 |
1.28 MB |
|
|
| |
Teri-Meri-Kahaani-2012-128Kbps(Songs.PK)
| |
|
[Songs.PK] Teri Meri Kahaani - 01 - Mukhtasar.mp3 |
6.12 MB |
|
| |
|
[Songs.PK] Teri Meri Kahaani - 02 - Allah Jaane.mp3 |
6.51 MB |
|
| |
|
[Songs.PK] Teri Meri Kahaani - 03 - Jabse Mere Dil Ko Uff.mp3 |
5.41 MB |
|
| |
|
[Songs.PK] Teri Meri Kahaani - 04 - Humse Pyaar Kar Le Tu.mp3 |
7.13 MB |
|
| |
|
[Songs.PK] Teri Meri Kahaani - 05 - That's All I Really Wanna Do.mp3 |
4.61 MB |
|
| |
|
[Songs.PK] Teri Meri Kahaani - 06 - Mukhtasar (Remix).mp3 |
7.77 MB |
|
| |
|
[Songs.PK] Teri Meri Kahaani - 07 - Humse Pyaar Kar Le Tu (Remix).mp3 |
6.08 MB |
|
| |
|
Teri Meri Kahaani - Cover.jpg |
394.34 KB |
|
|
| |
Tezz-128Kbps-2012(Songs.PK)
| |
|
[Songs.PK] Tezz - 01 - Tere Bina.mp3 |
6.02 MB |
|
| |
|
[Songs.PK] Tezz - 02 - Tezz (Female Version).mp3 |
6.14 MB |
|
| |
|
[Songs.PK] Tezz - 03 - Main Hoon Shab.mp3 |
6.02 MB |
|
| |
|
[Songs.PK] Tezz - 04 - Laila.mp3 |
6.02 MB |
|
| |
|
[Songs.PK] Tezz - 05 - Tere Bina (Female Version).mp3 |
6.06 MB |
|
| |
|
[Songs.PK] Tezz - 06 - Tezz (Male Version).mp3 |
6.1 MB |
|
| |
|
[Songs.PK] Tezz - 07 - Laila (Remix).mp3 |
4.64 MB |
|
| |
|
[Songs.PK] Tezz - 08 - Tere Bina (Remix).mp3 |
5.92 MB |
|
| |
|
[Songs.PK] Tezz - 09 - Tezz (Female Remix).mp3 |
6.2 MB |
|
| |
|
[Songs.PK] Tezz - 10 - Tere Bina (Sad Version).mp3 |
4.15 MB |
|
| |
▼ And 1 file more
|
|
| |
Thank-You-2011-320Kbps(Songs.PK)
| |
|
Full Volume (Remix).mp3 |
8.37 MB |
|
| |
|
Full Volume.mp3 |
8.78 MB |
|
| |
|
My Hear Is Beating (Remix).mp3 |
9.35 MB |
|
| |
|
My Heart Is Beating.mp3 |
8.53 MB |
|
| |
|
Pyaar Do Pyaar Lo (Remix).mp3 |
9.42 MB |
|
| |
|
Pyaar Do Pyaar Lo .mp3 |
11.34 MB |
|
| |
|
Pyaar Mein.mp3 |
10.02 MB |
|
| |
|
Razia (Remix).mp3 |
9.25 MB |
|
| |
|
Razia.mp3 |
10.66 MB |
|
|
| |
The-Dirty-Picture-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] The Dirty Picture - 02 - Ishq Sufiyana (Male).mp3 |
6.57 MB |
|
| |
|
[Songs.PK] The Dirty Picture - 03 - Ishq Sufiyana (Female).mp3 |
6.79 MB |
|
| |
|
[Songs.PK] The Dirty Picture - 04 - Honeymoon Ki Raat.mp3 |
5.37 MB |
|
| |
|
[Songs.PK] The Dirty Picture - 05 - Twinkle Twinkle.mp3 |
3.66 MB |
|
| |
|
[Songs.PK] The Dirty Picture - 06 - Ooh La La (Dhol Mix).mp3 |
4.87 MB |
|
| |
|
Ooh La La.mp3 |
4.88 MB |
|
|
| |
The-Film-Emotional-Atyachar
| |
|
[Songs.PK] Emotional Atyachar - 01 - Chitka Hua.mp3 |
5.33 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 02 - Emotional Atyachar.mp3 |
6.32 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 03 - Emotional Atyachar (Reloaded).mp3 |
5.96 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 04 - Ankhon Ne.mp3 |
5.26 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 05 - Don't go Away.mp3 |
4.72 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 06 - Kaafir.mp3 |
6.32 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 07 - Dekhun Raat Din.mp3 |
4.5 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 09 - Sun Liya.mp3 |
5.21 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 10 - Yaadon Ki.mp3 |
6.21 MB |
|
| |
|
[Songs.PK] Emotional Atyachar - 11 - Chalte Jana Hai.mp3 |
6.83 MB |
|
| |
|
Soniya.mp3 |
5.56 MB |
|
|
| |
Three
| |
|
Akash 1.mp3 |
2.7 MB |
|
| |
|
Akash 2.mp3 |
2.05 MB |
|
| |
|
Akash 3.mp3 |
2.79 MB |
|
| |
|
Akash 4.mp3 |
2.22 MB |
|
|
| |
Toh Baat Pakki
| |
|
Akash 1.mp3 |
7.61 MB |
|
| |
|
Akash 2.mp3 |
12.83 MB |
|
| |
|
Akash 3.mp3 |
7.08 MB |
|
| |
|
Akash 4.mp3 |
12.13 MB |
|
| |
|
Akash 5.mp3 |
9.86 MB |
|
| |
|
Akash 6.mp3 |
8.56 MB |
|
| |
|
Akash 7.mp3 |
8.78 MB |
|
|
| |
Tum-Hi-To-Ho-128Kbps(Songs.PK)
| |
|
[Songs.PK] Tum Hi To Ho - 01 - Dil Ne Mere Dil Ne.mp3 |
6.73 MB |
|
| |
|
[Songs.PK] Tum Hi To Ho - 02 - Rock You Baby.mp3 |
4.42 MB |
|
| |
|
[Songs.PK] Tum Hi To Ho - 03 - Teri Shame Mere Sabere.mp3 |
5.16 MB |
|
| |
|
[Songs.PK] Tum Hi To Ho - 04 - Aaye Khuda Dard Ye Gum.mp3 |
6.27 MB |
|
| |
|
[Songs.PK] Tum Hi To Ho - 05 - Tum Hi To Ho.mp3 |
5.65 MB |
|
| |
|
[Songs.PK] Tum Hi To Ho - 06 - Ayo Manaye Jashn.mp3 |
5.55 MB |
|
|
| |
Tum mile
| |
|
tum mile (1).mp3 |
2.44 MB |
|
| |
|
tum mile (2).mp3 |
2.41 MB |
|
| |
|
tum mile (3).mp3 |
2.65 MB |
|
| |
|
tum mile (4).mp3 |
2.3 MB |
|
| |
|
tum mile.mp3 |
2.76 MB |
|
|
| |
Twist-And-Shout
| |
Disc 1
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 1 - 01 - I Love You.mp3 |
5.15 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 1 - 02 - Dost Karleh Toast.mp3 |
5.44 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 1 - 03 - Holi Holi Nach.mp3 |
4.55 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 1 - 04 - Roop Tera Mastana.mp3 |
5.74 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 1 - 05 - Kehde You Love Me.mp3 |
5.26 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 1 - 06 - Twist & Shout.mp3 |
4.58 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 1 - 07 - Desi Nukhre.mp3 |
3.84 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 1 - 08 - Kaun Hain Woh (Who's That Girl).mp3 |
4.24 MB |
|
| |
|
Twist & Shout - Back.jpg |
364.88 KB |
|
| |
|
Twist & Shout - Front.jpg |
351.24 KB |
|
|
| |
Disc 2
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 01 - I Love You (Johnny Jockey House Mix).mp3 |
7.36 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 02 - Twist & Shout (Bollywood Style-Club... |
5.48 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 03 - Kaun Hain Woh (Who's That... |
5.11 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 04 - Holi Holi Nach (Gang Bang Mix).mp3 |
4.46 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 05 - Holi Holi Nach (Club Mix).mp3 |
6.33 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 06 - I Love You (House Mix).mp3 |
5.65 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 07 - Dost Karleh Toast (House Mix).mp3 |
6.35 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 08 - Holi Holi Nach (Rap Mix).mp3 |
5.32 MB |
|
| |
|
[Songs.PK] Stereo Nation Twist & Shout Disc 2 - 09 - Desi Nukhre (Remix).mp3 |
3.86 MB |
|
|
|
| |
U-R-My-Jaan-2011-128Kbps(Songs.PK)
| |
|
[Songs.PK] U R My Jaan - 01 - Kya Kare Dil Bechara.mp3 |
4.68 MB |
|
| |
|
[Songs.PK] U R My Jaan - 02 - U R My Jaan.mp3 |
4.87 MB |
|
| |
|
[Songs.PK] U R My Jaan - 03 - Mera Maula Kare.mp3 |
5.96 MB |
|
| |
|
[Songs.PK] U R My Jaan - 04 - Mein Zamein Pe Hu.mp3 |
5.19 MB |
|
| |
|
[Songs.PK] U R My Jaan - 05 - Bin Tere We Mahi.mp3 |
6.33 MB |
|
| |
|
[Songs.PK] U R My Jaan - 06 - Chand Wahi Hai.mp3 |
4.93 MB |
|
|
| |
Veer
| |
|
VEER (1).mp3 |
1.02 MB |
|
| |
|
VEER (2).mp3 |
4.61 MB |
|
| |
|
VEER (3).mp3 |
4.35 MB |
|
| |
|
VEER (4).mp3 |
5.78 MB |
|
| |
|
VEER (5).mp3 |
4.47 MB |
|
| |
|
VEER.mp3 |
5.2 MB |
|
|
| |
Vicky Donor (2012)
| |
|
01 - Rokda.mp3 |
4.24 MB |
|
| |
|
02 - Kho Jaane De.mp3 |
4.67 MB |
|
| |
|
03 - Rum & Whisky.mp3 |
3.87 MB |
|
| |
|
04 - Pani Da Rang (Male).mp3 |
3.81 MB |
|
| |
|
05 - Mar Jayian (Romantic).mp3 |
4.55 MB |
|
| |
|
06 - Chaddha.mp3 |
3.66 MB |
|
| |
|
07 - Pani Da Rang (Female).mp3 |
4.56 MB |
|
| |
|
08 - Mar Jayian (Sad).mp3 |
4.02 MB |
|
|
| |
Wake up sid
| |
|
wake up sid (1).mp3 |
2.07 MB |
|
| |
|
wake up sid (2).mp3 |
2.08 MB |
|
| |
|
wake up sid (3).mp3 |
1.83 MB |
|
| |
|
wake up sid.mp3 |
1.9 MB |
|
|
| |
Wanted
| |
|
WANTED (1).mp3 |
2.01 MB |
|
| |
|
WANTED (2).mp3 |
2.21 MB |
|
| |
|
WANTED (3).mp3 |
2.06 MB |
|
| |
|
WANTED (4).mp3 |
2.33 MB |
|
| |
|
WANTED (5).mp3 |
2.24 MB |
|
| |
|
WANTED (6).mp3 |
1.87 MB |
|
| |
|
WANTED.mp3 |
2.17 MB |
|
|
| |
We-Are-Family
| |
|
Aaj Kal Zindagi.mp3 |
4.63 MB |
|
| |
|
Ankhon Mein Neendein.mp3 |
5.98 MB |
|
| |
|
Dil Khol Ke Let's Rock.mp3 |
4.67 MB |
|
| |
|
Hamesha & Forever.mp3 |
5.27 MB |
|
| |
|
Kabhi Alvida Naa Kehna.mp3 |
9.12 MB |
|
| |
|
Kal Ho Naa Ho.mp3 |
5.9 MB |
|
| |
|
Noor E Khuda.mp3 |
7.21 MB |
|
| |
|
Reham O Karam.mp3 |
6.56 MB |
|
| |
|
Sun le Dua Yeh Aasman (Theme Slow Version).mp3 |
4.21 MB |
|
| |
|
We Are Family (Theme).mp3 |
3.18 MB |
|
|
| |
Yamla-Pagla-Deewana
| |
|
Chamki Jawaani - Yamla Pagla Deewana.mp3 |
7.55 MB |
|
| |
|
Charha De Rang (Pervez Adlib Version) - Yamla Pagla Deewana.mp3 |
1.91 MB |
|
| |
|
Charha De Rang (Rahat Adlib Version) - Yamla Pagla Deewana.mp3 |
2.25 MB |
|
| |
|
Charha De Rang (Ver.2)- Yamla Pagla Deewana.mp3 |
5.83 MB |
|
| |
|
Charha De Rang - Yamla Pagla Deewana.mp3 |
5.7 MB |
|
| |
|
Gurbani - Yamla Pagla Deewana.mp3 |
1.35 MB |
|
| |
|
Kadd Ke Botal - Yamla Pagla Deewana.mp3 |
5.83 MB |
|
| |
|
Sau Baar - Yamla Pagla Deewana.mp3 |
4.86 MB |
|
| |
|
Son Titariya - Yamla Pagla Deewana.mp3 |
4.49 MB |
|
| |
|
Tinku Jiya - Yamla Pagla Deewana.mp3 |
6.34 MB |
|
| |
▼ And 1 file more
|
|
| |
Yeh-Saali-Zindagi-128Kbps(Songs.PK)
| |
|
Dil Dar-Ba-Dar.mp3 |
7.05 MB |
|
| |
|
Ishq Tere Jalwe.mp3 |
6.51 MB |
|
| |
|
Kaise Kahein Alvida.mp3 |
4.74 MB |
|
| |
|
Sararara (Zindagi Nikal Chali Sararara).mp3 |
6.48 MB |
|
| |
|
Sararara.mp3 |
6.63 MB |
|
| |
|
Yeh Saali Zindagi (Bonus Song).mp3 |
3.79 MB |
|
| |
|
Yeh Saali Zindagi (Duet).mp3 |
5.7 MB |
|
| |
|
Yeh Saali Zindagi (Female).mp3 |
5.72 MB |
|
|
| |
Yuvvraaj
| |
|
y (1).mp3 |
3.05 MB |
|
| |
|
y (2).mp3 |
2.7 MB |
|
| |
|
y (3).mp3 |
3.64 MB |
|
| |
|
y (4).mp3 |
3.01 MB |
|
| |
|
y (5).mp3 |
1.6 MB |
|
| |
|
y (6).mp3 |
704.73 KB |
|
| |
|
y.mp3 |
2.98 MB |
|
|
| |
Zindagi-Na-Milegi-Dobara-2011
| |
|
01 - Dil Dhadakne Do.mp3 |
4.61 MB |
|
| |
|
02 - Ik Junoon (Paint It Red).mp3 |
5.9 MB |
|
| |
|
03 - Khaabon Ke Parinday.mp3 |
4.52 MB |
|
| |
|
04 - Senorita.mp3 |
4.57 MB |
|
| |
|
05 - Der Lagi Lekin.mp3 |
5.95 MB |
|
| |
|
06 - Sooraj Ki Baahon Mein.mp3 |
4.06 MB |
|
| |
|
07 - Toh Zinda Ho Tum.mp3 |
2.05 MB |
|
| |
|
08 - Ik Junoon (Remix).mp3 |
4.78 MB |
|
| |
|
09 - Senorita (Remix).mp3 |
5.62 MB |
|
| |
|
Zindagi Na Milegi Dobara - Front Cover.jpg |
350.16 KB |
|
|
All Comments
Comment as a guest or sign-in
User Opinions